This is free and unencumbered software released into the public domain. More...
Namespaces | |
| namespace | GSL |
| namespace | Lo |
| Namespace for all Isis Lunar Orbiter mission objects. | |
| namespace | Lro |
| Namespace for all Isis Lunar Reconnaissance Orbiter mission objects. | |
| namespace | Message |
| namespace | Mgs |
| Namespace for all Isis Mars Global Surveyor mission objects. | |
| namespace | Mro |
| Namespace for all Isis Mars Reconnaissance Orbiter mission objects. | |
| namespace | Odyssey |
| Namespace for all Isis Mars Odyssey mission objects. | |
| namespace | Radar |
| namespace | ShadowCam |
Classes | |
| class | AbstractFilter |
| Base class for control net filters. More... | |
| class | AbstractFilterSelector |
| Base class for filter selectors. More... | |
| class | AbstractImageItem |
| Base class for an image item in the tree. More... | |
| class | AbstractLeafItem |
| Base class for leaf items in the tree. More... | |
| class | AbstractMeasureItem |
| Base class for a measure item in the tree. More... | |
| class | AbstractMultipleChoiceFilter |
| Base class for combo box type filters. More... | |
| class | AbstractNullDataItem |
| Base class for an item without data. More... | |
| class | AbstractNumberFilter |
| Base class for filters that are number-based. More... | |
| class | AbstractParentItem |
| Base class for an item that is a parent in the tree. More... | |
| class | AbstractPlate |
| Abstract interface to a TIN plate. More... | |
| class | AbstractPlotTool |
| Parent class for plotting tools which provides common functionality. More... | |
| class | AbstractPointItem |
| Base class for a point item in the tree. More... | |
| class | AbstractProjectItemView |
| AbstractProjectItemView is a base class for views of a ProjectItemModel in Qt's model-view framework. More... | |
| class | AbstractStringFilter |
| Base class for filters that are string-based. More... | |
| class | AbstractTableDelegate |
| Base class for delegates which create, read, and save data in the tables. More... | |
| class | AbstractTableModel |
| Translates the tree model into a table model. More... | |
| class | AbstractTreeItem |
| Base class for an item in the tree. More... | |
| class | AbstractTreeModel |
| Base class for tree models. More... | |
| class | AdaptiveGruen |
| Gruen (adaptive) pattern matching. More... | |
| class | AdjustedLatitudeFilter |
| Allows filtering by adjusted surface point latitude. More... | |
| class | AdjustedLatitudeSigmaFilter |
| Allows filtering by adjusted surface point latitude sigma. More... | |
| class | AdjustedLongitudeFilter |
| Allows filtering by adjusted surface point longitude. More... | |
| class | AdjustedLongitudeSigmaFilter |
| Allows filtering by adjusted surface point longitude sigma. More... | |
| class | AdjustedRadiusFilter |
| Allows filtering by adjusted surface point radius. More... | |
| class | AdjustedRadiusSigmaFilter |
| Allows filtering by adjusted surface point radius sigma. More... | |
| class | AdjustedXFilter |
| Allows filtering by adjusted surface point X. More... | |
| class | AdjustedXSigmaFilter |
| Allows filtering by adjusted surface point X sigma. More... | |
| class | AdjustedYFilter |
| Allows filtering by adjusted surface point Y. More... | |
| class | AdjustedYSigmaFilter |
| Allows filtering by adjusted surface point Y sigma. More... | |
| class | AdjustedZFilter |
| Allows filtering by adjusted surface point Z. More... | |
| class | AdjustedZSigmaFilter |
| Allows filtering by adjusted surface point Z sigma. More... | |
| class | AdvancedStretch |
| Advanced Stretch Dialog. More... | |
| class | AdvancedStretchDialog |
| Advanced Stretch Dialog. More... | |
| class | AdvancedTrackTool |
| Tool to display info for a point on a cube. More... | |
| class | Affine |
| Affine basis function. More... | |
| class | AffineRadio |
| Container for affine and radiometric parameters. More... | |
| struct | AffineTolerance |
| Container for Affine limits parameters. More... | |
| class | Albedo |
| Albedo normalization. More... | |
| class | AlbedoAtm |
| Albedo normalization with atmosphere. More... | |
| class | AlphaCube |
| This class is used to rewrite the "alpha" keywords out of the AlphaCube group or Instrument group. More... | |
| struct | Analysis |
| Error analysis of Gruen match point solution. More... | |
| class | Angle |
| Defines an angle and provides unit conversions. More... | |
| class | Anisotropic1 |
| class | Anisotropic2 |
| class | Apollo |
| Reads user Apollos from a data file. More... | |
| class | ApolloMetricCamera |
| Apollo Metric Camera Model. More... | |
| class | ApolloMetricDistortionMap |
| Apollo Metric Distortion Map. More... | |
| class | ApolloPanIO |
| Calculates a series of affine transformations from the measured coordinates of the up to 90 fiducial marks on a complete (stiched) apollo panoramic cube. More... | |
| class | ApolloPanoramicCamera |
| Apollo Panoramic Camera. More... | |
| class | ApolloPanoramicDetectorMap |
| Convert between parent image (aka encoder aka machine) coordinates and detector coordinates. More... | |
| class | Application |
| class | APrioriLatitudeFilter |
| Allows filtering by a priori surface point latitude. More... | |
| class | APrioriLatitudeSigmaFilter |
| Allows filtering by a priori surface point latitude sigma. More... | |
| class | APrioriLongitudeFilter |
| Allows filtering by a priori surface point longitude. More... | |
| class | APrioriLongitudeSigmaFilter |
| Allows filtering by a priori surface point longitude sigma. More... | |
| class | APrioriRadiusFilter |
| Allows filtering by a priori surface point radius. More... | |
| class | APrioriRadiusSigmaFilter |
| Allows filtering by a priori surface point radius sigma. More... | |
| class | APrioriXFilter |
| Allows filtering by a priori surface point X. More... | |
| class | APrioriXSigmaFilter |
| Allows filtering by a priori surface point X sigma. More... | |
| class | APrioriYFilter |
| Allows filtering by a priori surface point Y. More... | |
| class | APrioriYSigmaFilter |
| Allows filtering by a priori surface point Y sigma. More... | |
| class | APrioriZFilter |
| Allows filtering by a priori surface point Z. More... | |
| class | APrioriZSigmaFilter |
| Allows filtering by a priori surface point Z sigma. More... | |
| class | Area3D |
| Represents a 3D area (a 3D "cube"). More... | |
| struct | ArrayRemoval |
| Policy for deleting arrays that CollectorMap owns. More... | |
| class | AtmosModel |
| Isotropic atmos scattering model. More... | |
| class | AtmosModelFactory |
| This class is used to create AtmosModel objects. More... | |
| class | AutoReg |
| Auto Registration class. More... | |
| class | AutoRegFactory |
| This class is used to create AutoReg objects. More... | |
| class | Average |
| Functor for reduce using average functionality. More... | |
| class | BandManager |
| Buffer manager, for moving through a cube in bands. More... | |
| class | BandSpinBox |
| class | BandTool |
| class | Basis1VariableFunction |
| Time based linear equation class. More... | |
| class | BasisFunction |
| Generic linear equation class. More... | |
| class | BinaryStretchType |
| This handles the advanced binary stretch. More... | |
| class | BlinkTool |
| class | Blobber |
| Base class for accessing ISIS blobs. More... | |
| class | BoxcarCachingAlgorithm |
| This algorithm is designed for applications that jump around between a couple of spots in the cube with a difficult to predict pattern but always the same places in the cube. More... | |
| class | BoxcarManager |
| Buffer manager, for moving through a cube by boxcar. More... | |
| class | Brick |
| Buffer for containing a three dimensional section of an image. More... | |
| class | BrowseDialog |
| Class for browsing cubes. More... | |
| class | Buffer |
| Buffer for reading and writing cube data. More... | |
| class | BufferManager |
| Manages a Buffer over a cube. More... | |
| class | BulletAllHitsRayCallback |
| Bullet ray tracing callback to return all intersections along a ray's path. More... | |
| class | BulletClosestRayCallback |
| Bullet ray tracing callback for closest hit on target surface. More... | |
| class | BulletDskShape |
| Bullet Target Shape for NAIF type 2 DSK models. More... | |
| class | BulletShapeModel |
| Shape model that uses the Bullet library to perform ray tracing. More... | |
| class | BulletTargetShape |
| Bullet Target Shape for planetary bodies. More... | |
| class | BulletWorldManager |
| Bullet World manager maintains a proper state for target bodies. More... | |
| class | BundleAdjust |
| An image bundle adjustment object. More... | |
| class | BundleControlPoint |
| This class holds information about a control point that BundleAdjust needs to run correctly. More... | |
| class | BundleImage |
| This class hold image information that BundleAdjust needs to run correctly.Definition for a BundleImageQsp, a shared pointer to a BundleImage. More... | |
| class | BundleLidarControlPoint |
| This class holds information about a lidar control point that BundleAdjust requires. More... | |
| class | BundleLidarPointVector |
| This class is a container class for BundleLidarControlPoints. More... | |
| class | BundleLidarRangeConstraint |
| Implements range constraint between image position and lidar point acquired simultaneously with the image. More... | |
| class | BundleMeasure |
| A container class for a ControlMeasure. More... | |
| class | BundleObservation |
| Abstract base class for an observation in bundle adjustment. More... | |
| class | BundleObservationSolveSettings |
| This class is used to modify and manage solve settings for 1 to many BundleObservations. More... | |
| class | BundleObservationVector |
| This class is a container class for BundleObservations. More... | |
| class | BundleObservationView |
| View for displaying BundleObservation CSV files. More... | |
| class | BundleObservationViewWorkOrder |
| This is a child of the WorkOrder class which is used for anything that performs an action in a Project. More... | |
| class | BundleResults |
| A container class for statistical results from a BundleAdjust solution. More... | |
| class | BundleSettings |
| Container class for BundleAdjustment settings. More... | |
| class | BundleSolutionInfo |
| Container class for BundleAdjustment results. More... | |
| class | BundleTargetBody |
| This class is used to represent a target body in a bundle and how to solve for it. More... | |
| class | BusyLeafItem |
| A leaf item that is not ready for user interaction. More... | |
| class | Calculator |
| Calculator for arrays. More... | |
| class | CalculatorVariablePool |
| This is a simple class to model a Calculator Variable Pool. More... | |
| class | Camera |
| class | CameraBuffers |
| This class is used to manage buffers for calculating camera related information, such as angles, radii, and resolution. More... | |
| class | CameraDetectorMap |
| Convert between parent image coordinates and detector coordinates. More... | |
| class | CameraDistortionMap |
| Distort/undistort focal plane coordinates. More... | |
| class | CameraFactory |
| Initializes a Camera Model. More... | |
| class | CameraFocalPlaneMap |
| Convert between distorted focal plane and detector coordinates. More... | |
| class | CameraGroundMap |
| Convert between undistorted focal plane and ground coordinates. More... | |
| class | CameraPointInfo |
| CameraPointInfo provides quick access to the majority of information avaliable from a camera on a point. More... | |
| class | CameraSkyMap |
| Convert between undistorted focal plane and ra/dec coordinates. More... | |
| class | CameraStatistics |
| Calculates a series of statistics pertaining to a Camera. More... | |
| class | Centroid |
| Selection class derived from the Pure Virtual Parent Class for all Selection classes. More... | |
| class | CentroidApolloPan |
| Selection class derived from the Pure Virtual Parent Class for all Selection classes. More... | |
| class | Chandrayaan1M3Camera |
| Chandrayaan1 M3 Camera Model. More... | |
| class | Chandrayaan1M3DistortionMap |
| Distortion map for the Chandrayaan1 M3 camera. More... | |
| class | Chandrayaan2OhrcCamera |
| Chandrayaan2 OHRC (Orbiter High-Resolution Camera) Camera Model. More... | |
| class | Chandrayaan2TmcCamera |
| Chandrayaan2 TMC (Terrain Mapping Camera) Camera Model. More... | |
| class | Chip |
| A small chip of data used for pattern matching. More... | |
| class | ChipViewport |
| Viewport for Isis Chips. More... | |
| class | ChipViewportsWidget |
| Scrolled widget for display ChipViewports. More... | |
| class | ChooserNameFilter |
| Allows filtering by the chooser name. More... | |
| class | CisscalFile |
| Extends TextFile to handle Cassini ISS calibration files. More... | |
| class | CissLabels |
| Read values from Cassini ISS labels. More... | |
| class | ClementineUvvisDistortionMap |
| Distortion map for the Clementine UVVIS camera. More... | |
| class | ClipperNacRollingShutterCamera |
| Clipper EIS Camera model. More... | |
| class | ClipperPushBroomCamera |
| This is the camera model for the Europa Clipper Push Broom Camera. More... | |
| class | ClipperWacFcCamera |
| This is the camera model for the Europa Clipper WAC Framing Camera. More... | |
| class | CloseProjectWorkOrder |
| This opens a project that's saved on disk. More... | |
| class | CnetDisplayProperties |
| Handles how control networks should be displayed to the user. More... | |
| class | CnetEditorSortConfigDialog |
| Configure user's sorting settings for the cneteditor widget. More... | |
| class | CnetEditorView |
| Ipce view containing the CnetEditorWidget. More... | |
| class | CnetEditorViewWorkOrder |
| This work order allows the user to open a cnet editor (table) view of a single control network. More... | |
| class | CnetEditorWidget |
| This widget provides full editing, filtering and viewing capabilities for the raw data in a control network. More... | |
| class | CollectorMap |
| Collector/container for arbitrary items. More... | |
| class | Color |
| This class is designed to serialize QColor in a human-readable form. More... | |
| class | Column |
| Format ascii tables. More... | |
| class | ConcurrentControlNetReader |
| This reads a control net in the background. More... | |
| class | ConnectionParentItem |
| Tree item that is a parent and represents an image. More... | |
| class | Control |
| This represents an ISIS control net in a project-based GUI interface. More... | |
| class | ControlDisplayProperties |
| This is the GUI communication mechanism for cubes. More... | |
| class | ControlHealthMonitorView |
| View for the Control Net Health Monitor. More... | |
| class | ControlHealthMonitorWidget |
| Interface that allows real-time evaluation of the state of a Control Network. More... | |
| class | ControlHealthMonitorWorkOrder |
| This is a child of class WorkOrder which is used for anything that performs an action in a Project. More... | |
| class | ControlList |
| Maintains a list of Controls so that control nets can easily be copied from one Project to another, saved to disk, or deleted from disk. More... | |
| class | ControlMeasure |
| a control measurement More... | |
| class | ControlMeasureEditWidget |
| Point Editor Widget. More... | |
| class | ControlMeasureLogData |
| Statistical and similar ControlMeasure associated information. More... | |
| class | ControlNet |
| a control network More... | |
| class | ControlNetDiff |
| Compares two Control Networks and reports their differences. More... | |
| class | ControlNetFilter |
| Filter Control Network. More... | |
| class | ControlNetGraphicsItem |
| Control Network Display on Mosaic Scene. More... | |
| class | ControlNetStatistics |
| Control Network Stats. More... | |
| class | ControlNetTool |
| ControlNetTool Handles mouse events on CubeDnViews for control point editing for the ipce app. More... | |
| class | ControlNetValidMeasure |
| ControlNetValidMeasure class. More... | |
| class | ControlNetVersioner |
| Handle various control network file format versions. More... | |
| class | ControlNetVitals |
| ControlNetVitals. More... | |
| class | ControlPoint |
| A single control point. More... | |
| class | ControlPointEdit |
| Point Editor Widget. More... | |
| class | ControlPointEditView |
| View for editing a single ControlPoint. More... | |
| class | ControlPointEditWidget |
| Gui for editing ControlPoints in ipce application. More... | |
| class | ControlPointGraphicsItem |
| The visual display of a single control point. More... | |
| class | ControlPointList |
| Control Point List generator. More... | |
| class | ControlPointV0001 |
| A container for the information stored in a version 1 ControlPoint. More... | |
| class | ControlPointV0002 |
| A container for the information stored in a version 2 ControlPoint. More... | |
| class | ControlPointV0003 |
| A container for the information stored in a version 3 and 4 ControlPoint. More... | |
| class | Coordinate |
| Define a generic Y/X container. More... | |
| class | CorrelationMatrix |
| This is a container for the correlation matrix that comes from a bundle adjust. More... | |
| class | CrismCamera |
| MRO CRISM camera model. More... | |
| class | CsmBundleObservation |
| Class for observations that use CSM camera models in bundle adjustment. More... | |
| class | CSMCamera |
| class | CsmSensor |
| Implementation of the SensorUtilities::Sensor interface for a CSM RasterGM model. More... | |
| class | CSMSkyMap |
| Convert between undistorted focal plane and ra/dec coordinates. More... | |
| class | CSVParser |
| CSV Parser seperates fields (tokens) from a string with a delimeter. More... | |
| class | CSVReader |
| Reads strings and parses them into tokens separated by a delimiter character. More... | |
| class | CTXCamera |
| MRO CTX Camera Model. More... | |
| class | Cube |
| IO Handler for Isis Cubes. More... | |
| class | CubeAttribute |
| Parent class for CubeAttributeInput and CubeAttributeOutput. More... | |
| class | CubeAttributeInput |
| Manipulate and parse attributes of input cube filenames. More... | |
| class | CubeAttributeOutput |
| Manipulate and parse attributes of output cube filenames. More... | |
| class | CubeBsqHandler |
| IO Handler for Isis Cubes using the BSQ format. More... | |
| class | CubeCachingAlgorithm |
| This is the parent of the caching algorithms. More... | |
| class | CubeCalculator |
| Calculator for arrays. More... | |
| class | CubeDataThread |
| Encapsulation of Cube I/O with Change Notifications. More... | |
| class | CubeDataThreadTester |
| class | CubeDnView |
| View that displays cubes in a QView-like way. More... | |
| class | CubeDnViewWorkOrder |
| This work order is designed to bring up a qview-like view for a small number of cubes. More... | |
| class | CubeInfixToPostfix |
| Converter for math equations. More... | |
| class | CubeIoHandler |
| Handles converting buffers to and from disk. More... | |
| class | CubeManager |
| Class for quick re-accessing of cubes based on file name. More... | |
| class | CubePlotCurve |
| This is a plot curve with information relating it to a particular cube or region of a cube. More... | |
| class | CubePlotCurveConfigureDialog |
| This should be an inner class for CubePlotCurve, but Qt doesn't support having a QObject as an inner class. More... | |
| class | CubeStretch |
| Stores stretch information for a cube. More... | |
| class | CubeTileHandler |
| IO Handler for Isis Cubes using the tile format. More... | |
| class | CubeViewport |
| Widget to display Isis cubes for qt apps. More... | |
| class | Database |
| Isis database class providing generalized access to a variety of databases. More... | |
| class | DatabaseFactory |
| Create database interfaces using access profiles or generic drivers. More... | |
| class | DataValue |
| This class is used to define what kind of data is being pushed onto the cube calculator. More... | |
| class | DawnFcCamera |
| This is the camera model for the Dawn Framing Camera. More... | |
| class | DawnFcDistortionMap |
| class | DawnVirCamera |
| Camera model for both Danw VIR VIS and IR instruments. More... | |
| class | DbAccess |
| DbAccess manages programatic access to a database through profiles. More... | |
| class | DbProfile |
| A DbProfile is a container for access parameters to a database. More... | |
| struct | DefaultCopy |
| (Default) Policy for copying map elements More... | |
| class | DemShape |
| Define shapes and provide utilities for targets stored as ISIS maps. More... | |
| class | Directory |
| class | Displacement |
| Displacement is a signed length, usually in meters. More... | |
| class | DisplayProperties |
| class | Distance |
| Distance measurement, usually in meters. More... | |
| class | EditTool |
| Interactive image edit tool. More... | |
| class | EllipsoidShape |
| Define shapes and provide utilities for ISIS targets. More... | |
| class | EmbreeShapeModel |
| General purpose Embree ray tracing model. More... | |
| class | EmbreeTargetManager |
| Class for managing the construction and destruction of EmbreeTargetShapes. More... | |
| class | EmbreeTargetShape |
| Embree Target Shape for planetary bodies. More... | |
| class | EndianSwapper |
| Byte swapper. More... | |
| class | Enlarge |
| Enlarge the pixel dimensions of an image. More... | |
| class | Environment |
| class | Equalization |
| This class can be used to calculate, read in, and/or apply equalization statistics for a list of files. More... | |
| class | EquatorialCylindricalShape |
| Define shapes and provide utilities for shapes stored as ISIS EquatorialCylindrical map. More... | |
| class | Equirectangular |
| Equirectangular Map Projection. More... | |
| class | ExportControlNetWorkOrder |
| Write a project control network to a user-specified location. More... | |
| class | ExportDescription |
| Describes how a series of cubes should be exported. More... | |
| class | ExportImagesWorkOrder |
| Write project images to a user-specified location. More... | |
| class | ExportPdsTable |
| Export a PDS table from an ISIS Table. More... | |
| class | FeatureNomenclature |
| Feature nomenclature database querier. More... | |
| class | FeatureNomenclatureTool |
| Display nomenclature on MDI Cube Viewports. More... | |
| class | FileDialog |
| Class for browsing cubes. More... | |
| class | FileItem |
| A container for a filename to be represented as a ProjectItem on the project tree. More... | |
| class | FileList |
| Internalizes a list of files. More... | |
| class | FileTool |
| class | FilterCachingAlgorithm |
| This algorithm is designed for applications that use ProcessByQuickFilter or very similar I/O patterns to cache cube data appropriately. More... | |
| class | FilterGroup |
| This class provides an interface for a group of filters. More... | |
| class | FilterWidget |
| This widget contains filtering capabilities for a single filter type. More... | |
| class | FindSpotGraphicsItem |
| The visual display of the find point. More... | |
| class | FindTool |
| Tool to locate a point on a cube that is projected and/or has a camera model. More... | |
| class | Footprint2DView |
| View for displaying footprints of images in a QMos like way. More... | |
| class | Footprint2DViewWorkOrder |
| View an image list's footprints in a footprint view. More... | |
| class | ForstnerOperator |
| Forstner interest operator. More... | |
| class | FourierTransform |
| Fourier Transform class. More... | |
| class | FramingCamera |
| Generic class for Framing Cameras. More... | |
| class | FunctionTools |
| A collection of tools for mathmatical function root finding, maximization, etc (eventually) This class contains only static methods, and cannot be instantiated. More... | |
| class | FxBinder |
| This is the parent class to the various function classes. More... | |
| class | GainChannelNormalize |
| Computes a gain correction for each sample GainChannelNormalize. More... | |
| class | GainFlatField |
| GainFlatField Module - Computes flat field correction for sample. More... | |
| class | GainLineDrift |
| Computes a gain correction for each line (Zg Module). More... | |
| class | GainNonLinearity |
| GainNonLinearity Module - Applies non-linear, line-dependant gain. More... | |
| class | GainTemperature |
| GaingTemperature Module - Applies temperature-dependant gain correction (column). More... | |
| class | GainUnitConversion |
| Computes units parameters for HiRISE data calibration (Ziof Module). More... | |
| class | GaussianDistribution |
| gaussian distribution class More... | |
| class | GaussianStretch |
| Gaussian stretch class. More... | |
| class | GdalIoHandler |
| Handles converting buffers to and from disk. More... | |
| class | GisGeometry |
| Encapsulation class provides support for GEOS-C API. More... | |
| class | GisTopology |
| This class models GIS topology. More... | |
| class | GoodnessOfFitFilter |
| Allows filtering by goodness of fit. More... | |
| class | GradientOperator |
| Gradient interest operator. More... | |
| class | GraphicsView |
| class | GridGraphicsItem |
| The visual display of the find point. More... | |
| class | GridPolygonSeeder |
| Seed points using a grid. More... | |
| class | GroundGrid |
| Calculates a lat/lon grid over an area. More... | |
| class | GroundTab |
| class | GroupedStatistics |
| Grouped Statistics. More... | |
| class | Gruen |
| Gruen pattern matching algorithm. More... | |
| class | Gui |
| Gui for Isis Applications. More... | |
| class | GuiBooleanParameter |
| class | GuiCamera |
| Container class for GuiCamera. More... | |
| class | GuiCameraDisplayProperties |
| The GUI communication mechanism for target body objects. More... | |
| class | GuiCameraList |
| List of GuiCameras saved as QSharedPointers. More... | |
| class | GuiComboBoxParameter |
| class | GuiCubeParameter |
| class | GuiDoubleParameter |
| class | GuiEditFile |
| Opens a window in Gui Application to be able to edit, save and create text files. More... | |
| class | GuiFileNameParameter |
| class | GuiHelperAction |
| class | GuiInputAttribute |
| GUI interface for input cube file attributes. More... | |
| class | GuiIntegerParameter |
| class | GuiListParameter |
| class | GuiLog |
| class | GuiOutputAttribute |
| class | GuiParameter |
| class | GuiParameterFactory |
| class | GuiStringParameter |
| class | Hapke |
| Hapke-Henyey-Greenstein photometric model. More... | |
| class | HapkeAtm1 |
| Implements the Hapke Atmospheric Model. More... | |
| class | HapkeAtm2 |
| class | HayabusaAmicaCamera |
| This is the camera model for the Hayabusa AMICA camera. More... | |
| class | HayabusaNirsCamera |
| This is the camera model for the Hayabusa NIRS camera. More... | |
| class | HelpTool |
| Qisis Help Tool. More... | |
| class | HiBlob |
| BLOB extraction class. More... | |
| class | HiCalData |
| Container for HiRISE calibration data. More... | |
| class | HiEqualization |
| class | HiHistory |
| class | HiLab |
| Process HiRise label. More... | |
| class | HiLineTimeEqn |
| Compute HiRISE line times. More... | |
| class | Hillshade |
| Calculate light intensity reflected off a local slope of DEM. More... | |
| class | HiresCamera |
| This is the camera model for the Clementine High-Resolution Camera. More... | |
| class | HiriseCamera |
| Hirise Camera Model. More... | |
| class | Histogram |
| Container of a cube histogram. More... | |
| class | HistogramItem |
| This is the (qwt) plot item for a histogram. More... | |
| class | HistogramPlotWindow |
| class | HistogramTool |
| Tool for histograms. More... | |
| class | HistogramWidget |
| Histogram widget used by AdvancedStretchTool. More... | |
| class | History |
| class | HistoryTreeWidget |
| History Widget for ipce. More... | |
| class | HrscCamera |
| HRSC Camera Model. More... | |
| class | Hyb2OncCamera |
| This is the camera model for the Hayabusa2 ONC camera. More... | |
| class | Hyb2OncDistortionMap |
| Distort/undistort focal plane coordinates for Hayabusa 2's ONC cameras. More... | |
| class | ID |
| Creates sequential IDs. More... | |
| class | IdealCamera |
| Ideal Camera Model. More... | |
| class | Image |
| This represents a cube in a project-based GUI interface. More... | |
| class | ImageDisplayProperties |
| This is the GUI communication mechanism for cubes. More... | |
| class | ImageExporter |
| Export Isis cubes into standard formats. More... | |
| class | ImageFileListViewWorkOrder |
| View an image list in an image file list widget. More... | |
| class | ImageFileListWidget |
| A colored, grouped cube list. More... | |
| class | ImageHistogram |
| Container of a cube histogram. More... | |
| class | ImageIdFilter |
| Allows filtering by image ID. More... | |
| class | ImageImageFilterSelector |
| Allows users to choose filters for filtering connected images. More... | |
| class | ImageImageTreeModel |
| Tree model for images and images. More... | |
| class | ImageImporter |
| Imports images with standard formats into Isis as cubes. More... | |
| class | ImageIoHandler |
| Handles converting buffers to and from disk. More... | |
| class | ImageLeafItem |
| Tree item that is a leaf and represents an image. More... | |
| class | ImageList |
| Internalizes a list of images and allows for operations on the entire list. More... | |
| class | ImageListActionWorkOrder |
| Work orders that can be performed on an image list that modifies internal state. More... | |
| class | ImageOverlap |
| Individual overlap container. More... | |
| class | ImageOverlapSet |
| This class is used to find the overlaps between all the images in a list of serial numbers. More... | |
| class | ImageParentItem |
| Tree item that is a parent and represents an image. More... | |
| class | ImagePointFilterSelector |
| Allows users to choose filters for filtering images and points. More... | |
| class | ImagePointTreeModel |
| Tree model for images and control points. More... | |
| class | ImagePolygon |
| Create cube polygons, read/write polygons to blobs. More... | |
| class | ImageReader |
| class | ImageTab |
| class | ImageTreeWidget |
| class | ImageTreeWidgetItem |
| class | ImportControlNetWorkOrder |
| Add control networks to a project c Asks the user for a list of control nets and copies them into the project. More... | |
| class | ImportImagesWorkOrder |
| Add cubes to a project. More... | |
| class | ImportMapTemplateWorkOrder |
| Add map templates to a project. More... | |
| class | ImportPdsTable |
| Import a PDS table file with a label description. More... | |
| class | ImportRegistrationTemplateWorkOrder |
| Add registration templates to a project. More... | |
| class | ImportShapesWorkOrder |
| Add shape model cubes to a project. More... | |
| class | IndependentCubeViewport |
| General purpose Cube display widget. More... | |
| class | InfixFunction |
| InfixOperator and InfixFunction are helper classes for InfixToPostfix. More... | |
| class | InfixOperator |
| InfixOperator and InfixFunction are helper classes for InfixToPostfix. More... | |
| class | InfixToPostfix |
| Converter for math equations. More... | |
| class | InlineCalculator |
| Provides a calculator for inline equations. More... | |
| class | InlineInfixToPostfix |
| A parser for converting equation strings to postfix. More... | |
| class | InlineVoidFx |
| This class is used to bind function names with corresponding InlineCalculator functions that do not take parameters. More... | |
| class | Intercept |
| Container for a intercept condition. More... | |
| class | InterestOperator |
| Interest Operator class. More... | |
| class | InterestOperatorFactory |
| This class is used to create InterestOperator objects. More... | |
| class | Interpolator |
| Pixel interpolator. More... | |
| class | IProj |
| Proj Map Projection. More... | |
| class | IrregularBodyCameraGroundMap |
| Convert between undistorted focal plane and ground coordinates. More... | |
| class | IsisBody |
| Implementation of SensorUtilities::Body backed by an ISIS SpiceRotation. More... | |
| class | IsisBundleObservation |
| Class for observations that use ISIS camera models in bundle adjustment. More... | |
| class | IsisIlluminator |
| Implementation of SensorUtilities::Illuminator backed by an ISIS SpicePosition. More... | |
| class | IsisSensor |
| Implementation of SensorUtilities::Sensor backed by an ISIS camera model. More... | |
| class | IsisShape |
| Implementation of SensorUtilities::Shape backed by an ISIS ShapeModel. More... | |
| class | Isotropic1 |
| class | Isotropic2 |
| class | IssNACamera |
| Cassini ISS Narrow Angle Camera Model. More... | |
| class | IssWACamera |
| Cassini ISS Wide Angle Camera Model. More... | |
| class | iTime |
| Parse and return pieces of a time string. More... | |
| class | JigsawRunWidget |
| This dialog allows the user to select the bundle adjust parameters, run the bundle, and view the results. More... | |
| class | JigsawSetupDialog |
| class | JigsawWorkOrder |
| This work order allows the user to run a bundle adjustment (jigsaw). More... | |
| class | JP2Decoder |
| JPEG2000 decoder class. More... | |
| class | JP2Encoder |
| JPEG2000 encoder class. More... | |
| class | JP2Exporter |
| Exports cubes into JPEG 2000 images. More... | |
| class | JP2Importer |
| Imports JPEG 2000 images as Isis cubes. More... | |
| class | JunoCamera |
| Juno's JNC (JunoCam) camera model. More... | |
| class | JunoDistortionMap |
| Distort/undistort focal plane coordinates for Juno's JunoCam camera. More... | |
| class | KaguyaMiCamera |
| Kaguya MI Camera Model. More... | |
| class | KaguyaMiCameraDistortionMap |
| Distort/undistort focal plane coordinates. More... | |
| class | KaguyaTcCamera |
| This is the camera model for the Kaguya Terrain Cameras TC1 and TC2. More... | |
| class | KaguyaTcCameraDistortionMap |
| Distort/undistort focal plane coordinates for Kaguya's TC cameras. More... | |
| class | Kernel |
| This class stores Kernel information, including Type and kernel file names. More... | |
| class | KernelDb |
| KernelDb class. More... | |
| class | Kernels |
| Determine SPICE kernels defined in an ISIS file. More... | |
| class | LabelTranslationManager |
| Allows applications to translate simple text files. More... | |
| class | Lambert |
| class | LambertAzimuthalEqualArea |
| Lambert Azimuthal Equal Area Map Projection. More... | |
| class | LambertConformal |
| Lambert Conformal Map Projection. More... | |
| class | Latitude |
| This class is designed to encapsulate the concept of a Latitude. More... | |
| class | LatLonGridTool |
| Lat Lon Grid View Tool. More... | |
| class | LeastSquares |
| Generic least square fitting class. More... | |
| class | LidarControlPoint |
| A lidar control ControlPoint. More... | |
| class | LidarData |
| LidarData class. More... | |
| class | LightTimeCorrectionState |
| Provides interface to user configurable Light Time correction feature. More... | |
| class | LimitPolygonSeeder |
| Seed points using a grid. More... | |
| class | LinearAlgebra |
| This class holds all static methods to perform linear algebra operations on vectors and matrices. More... | |
| class | LinearStretchType |
| This handles the advanced linear stretch. More... | |
| class | LineEquation |
| Utility class for creating and using cartesean line equations. More... | |
| class | LineFilter |
| Allows filtering by a control measure's line. More... | |
| class | LineManager |
| Buffer manager, for moving through a cube in lines. More... | |
| class | LineRateChange |
| Container class for storing timing information for a section of an image. More... | |
| class | LineResidualFilter |
| Allows filtering by the line residual. More... | |
| class | LineScanCamera |
| Generic class for Line Scan Cameras. More... | |
| class | LineScanCameraDetectorMap |
| Convert between parent image coordinates and detector coordinates. More... | |
| class | LineScanCameraGroundMap |
| class | LineScanCameraSkyMap |
| Convert between undistorted focal plane and ra/dec coordinates. More... | |
| class | LineShiftFilter |
| Allows filtering by a control measure's line shift. More... | |
| class | LoadCSV |
| Provides generalized access to HiRISE calibration CSV files. More... | |
| class | LoCameraFiducialMap |
| Computes map from image coordinates to focal plane based on fiducials. More... | |
| class | LoHighCamera |
| Defines the Lunar Orbiter High Resolution camera class. More... | |
| class | LoHighDistortionMap |
| Distort/undistort focal plane coordinates. More... | |
| class | LoMediumCamera |
| Defines the Lunar Orbiter Medium Resolution camera class. More... | |
| class | LoMediumDistortionMap |
| Distort/undistort focal plane coordinates. More... | |
| class | LommelSeeliger |
| class | Longitude |
| This class is designed to encapsulate the concept of a Longitude. More... | |
| class | LowPassFilter |
| Compute a low pass filter from a Module class content. More... | |
| class | LroNarrowAngleCamera |
| LRO Narrow Angle Camera Model. More... | |
| class | LroNarrowAngleDistortionMap |
| Distort/undistort focal plane coordinates. More... | |
| class | LroWideAngleCamera |
| LRO Wide Angle Camera Model. More... | |
| class | LroWideAngleCameraDistortionMap |
| Distort/undistort focal plane coordinates. More... | |
| class | LroWideAngleCameraFocalPlaneMap |
| Distort/undistort focal plane coordinates. More... | |
| class | LunarAzimuthalEqualArea |
| Modified Lambert Azimuthal Equal-Area Map Projection. More... | |
| class | LunarLambert |
| Lunar (Lommel-Seeliger)-Lambert law photometric model Derive model albedo for Lunar (Lommel-Seeliger)-Lambert law. More... | |
| class | LunarLambertEmpirical |
| Empirical Lunar Lambert photometric model Derive model albedo using phase dependent Minnaert equation and calculated empirically. More... | |
| class | LunarLambertMcEwen |
| Moonpr photometric model Computes normalized albedo for the Moon, normalized to 0 degrees emission angle and 30 degrees illumination and phase angles. More... | |
| class | LwirCamera |
| This is the camera model for the Clementine Long-Wavelength Infrared Camera. More... | |
| class | MainWindow |
| Base class for the Qisis main windows. More... | |
| class | ManualStretchType |
| This handles arbitrary user-input stretches. More... | |
| class | MarciCamera |
| Marci Camera Model. More... | |
| class | MarciDistortionMap |
| Distort/undistort focal plane coordinates. More... | |
| class | Mariner10Camera |
| Mariner10 Camera Model. More... | |
| class | MatchPoint |
| Structure containing comprehensive registration info/results. More... | |
| class | MatchTool |
| Match tool operations. More... | |
| class | MatchToolNewPointDialog |
| class | Matrix |
| Matrix class. More... | |
| class | MatrixGraphicsScene |
| A graphics scene with improved user-interaction for use with the MatrixSceneWidget. More... | |
| class | MatrixGraphicsView |
| A graphics view that resizes in a more friendly way. More... | |
| class | MatrixOptions |
| This class holds the matrix color and focus information. More... | |
| class | MatrixOptionsDialog |
| This widget allows the user to modify the matrix display. More... | |
| class | MatrixSceneWidget |
| This widget encompasses the entire matrixDisplay scene. More... | |
| class | MatrixViewWorkOrder |
| This work order will open a MatrixSceneWidget and display the correlation matrix. More... | |
| class | MaximumCorrelation |
| Maximum correlation pattern matching. More... | |
| class | MaximumLikelihoodWFunctions |
| Class provides maximum likelihood estimation functions for robust parameter estimation, e.g. More... | |
| class | MdiCubeViewport |
| Cube display widget for certain Isis MDI applications. More... | |
| class | MdisCamera |
| MESSENGER MDIS NAC and WAC Camera Model. More... | |
| class | MeasureCountFilter |
| Allows filtering by the number of measures in a control point. More... | |
| class | MeasureIgnoredFilter |
| Allows filtering by a control measure's ignored status. More... | |
| class | MeasureJigsawRejectedFilter |
| Allows filtering by a control measure's jigsaw rejected status. More... | |
| class | MeasureLeafItem |
| A leaf node in the tree structure that represents a control measure. More... | |
| class | MeasureTableDelegate |
| Delegate for creating, reading, and saving data in the measure table. More... | |
| class | MeasureTableModel |
| Table model for control measures. More... | |
| class | MeasureTool |
| Tool for measuring distances. More... | |
| class | MeasureTypeFilter |
| Filters by measure type. More... | |
| class | MeasureValidationResults |
| MeasureValidationResults class. More... | |
| class | Mercator |
| Mercator Map Projection. More... | |
| class | MexHrscSrcCamera |
| This is the camera model for the Mex HRSC SRC Framing Camera. More... | |
| class | MinimumDifference |
| Minimum difference pattern matching. More... | |
| class | MiniRF |
| LRO Mini-RF SAR and Chandrayaan 1 Mini-RF SAR. More... | |
| class | Minnaert |
| Minnaert photometric model Derive model albedo using Minnaert equation. More... | |
| class | MinnaertEmpirical |
| Empirical Minnaert photometric model Derive model albedo using phase dependent Minnaert equation and calculated empirically. More... | |
| class | Mixed |
| Mixed albedo/topo normalization without atmosphere. More... | |
| class | MocLabels |
| Read values from MOC labels. More... | |
| class | MocNarrowAngleCamera |
| MOC Narrow Angle Camera Model. More... | |
| class | MocNarrowAngleSumming |
| Mars Global Surveyor MOC narrow angle summing class. More... | |
| class | MocWideAngleCamera |
| MOC Wide Angle Camera Model. More... | |
| class | MocWideAngleDetectorMap |
| Convert between parent image coordinates and detector coordinates. More... | |
| class | MocWideAngleDistortionMap |
| Distort/undistort focal plane coordinates. More... | |
| class | Module |
| Module manages HiRISE calibration vectors from various sources. More... | |
| class | Mollweide |
| Mollweide Map Projection. More... | |
| class | MoonAlbedo |
| Albedo dependent phase function normalization for the Moon. More... | |
| class | MoravecOperator |
| Moravec Interest Operator. More... | |
| class | MosaicAreaTool |
| This displays a box with a given distance from a point. More... | |
| class | MosaicController |
| class | MosaicControlNetTool |
| //TODO: Remove debug printout & comment // 2016-08-25 Tracie Sucharski - Checking Directory pointer for IPCE code not ideal. More... | |
| class | MosaicControlNetToolMovementConfigDialog |
| Configure qmos Control Net Tool's movement arrows. More... | |
| class | MosaicFindTool |
| This controls the 'Find' abilities in the MosaicSceneWidget. More... | |
| class | MosaicGraphicsScene |
| A graphics scene with improved user-interaction for use with the MosaicSceneWidget. More... | |
| class | MosaicGraphicsView |
| A graphics view that resizes in a more friendly way. More... | |
| class | MosaicGridTool |
| This controls the 'Grid' abilities in the MosaicSceneWidget. More... | |
| class | MosaicGridToolConfigDialog |
| Configure user's settings for the grid tool. More... | |
| class | MosaicMainWindow |
| class | MosaicPanTool |
| Handles panning operations for Isis qt apps. More... | |
| class | MosaicSceneItem |
| A single cube in the mosaic scene. More... | |
| class | MosaicSceneWidget |
| This widget encompasses the entire mosaic scene. More... | |
| class | MosaicSceneWorkOrder |
| Work order associated with a MosaicSceneWidget. More... | |
| class | MosaicSelectTool |
| Handles selection operations for Isis qt apps. More... | |
| class | MosaicTool |
| Base class for the MosaicTools. More... | |
| class | MosaicTrackTool |
| class | MosaicZoomTool |
| Handles zoom operations for Isis qt apps. More... | |
| class | MoveDownOneSceneWorkOrder |
| Move images, one by one, below the immediately-below intersecting image in a scene This workorder is synchronous and undoable. More... | |
| class | MoveToBottomSceneWorkOrder |
| Move images below all other images in a mosaic scene This workorder is synchronous and undoable. More... | |
| class | MoveToTopSceneWorkOrder |
| Move images on top of all other images in a mosaic scene This workorder is synchronous and undoable. More... | |
| class | MoveUpOneSceneWorkOrder |
| Move images, one by one, on top of the immediately-above intersecting image in a scene This workorder is synchronous and undoable. More... | |
| class | MsiCamera |
| NEAR Shoemaker MSI Camera Model. More... | |
| class | MultivariateStatistics |
| Container of multivariate statistics. More... | |
| class | NaifDskPlateModel |
| Implementation interface API for NAIF's DSK plate model. More... | |
| class | NaifDskShape |
| Provides support for NAIF's Digital Shape Kernel (DSK). More... | |
| class | NaifStatus |
| Class for checking for errors in the NAIF library. More... | |
| class | Nearest |
| Functor for reduce using near functionality. More... | |
| class | NewControlPointDialog |
| class | NewGroundSourceLocationDialog |
| Dialog used by ControlPointEditWidget to select a new location for ground source files. More... | |
| class | NewHorizonsLeisaCamera |
| This is the camera model for LEISA, New Hoirzon's infrared Spectrometer. More... | |
| class | NewHorizonsLorriCamera |
| This is the camera model for the LORRI Framing Camera. More... | |
| class | NewHorizonsLorriDistortionMap |
| New Horizons LORRI Distortion Map. More... | |
| class | NewHorizonsMvicFrameCamera |
| This is the camera model for the New Horizons MVIC Frame mode Camera. More... | |
| class | NewHorizonsMvicFrameCameraDistortionMap |
| Distort/undistort focal plane coordinates for New Horizons/MVIC frame sensor. More... | |
| class | NewHorizonsMvicTdiCamera |
| New Horizons Mvic Camera, Tdi mode. More... | |
| class | NewHorizonsMvicTdiCameraDistortionMap |
| Distort/undistort focal plane coordinates for New Horizons/MVIC. More... | |
| class | NirCamera |
| This is the camera model for the Clementine Near Infrared Camera. More... | |
| class | NirsDetectorMap |
| The detector map class for the Hayabusa NIRS camera. More... | |
| struct | NoCaseStringCompare |
| Provides a case insensitive string comparison. More... | |
| class | NomenclatureToolConfigDialog |
| Configure user's settings for the nomenclature tool. More... | |
| class | NonLinearLSQ |
| NonLinearLSQ Computes a fit using a Levenberg-Marquardt algorithm. More... | |
| class | NoNormalization |
| NoNormalization - perform simple correction without normalization (a*dn +b). More... | |
| class | NoOperator |
| no interest operator More... | |
| struct | NoopRemoval |
| Supplies a NOOP default for removal of a CollectorMap entry. More... | |
| class | NormModel |
| class | NormModelFactory |
| This class is used to create NormModel objects. More... | |
| class | NthOrderPolynomial |
| NthOrderPolynomial basis function. More... | |
| class | NumericalApproximation |
| NumericalApproximation provides various numerical analysis methods of interpolation, extrapolation and approximation of a tabulated set of x, y data. More... | |
| class | NumericalAtmosApprox |
| This class extends Isis::NumericalApproximation. More... | |
| class | ObliqueCylindrical |
| Oblique Cylindrical Map Projection. More... | |
| class | ObservationNumber |
| Serial Number composer. More... | |
| class | ObservationNumberList |
| Create a list of observation numbers from a file or serial number list. More... | |
| class | OpenProjectWorkOrder |
| This opens a project that's saved on disk. More... | |
| class | OriginalLabel |
| Read and store original labels. More... | |
| class | OriginalXmlLabel |
| Read and store original Xml labels. More... | |
| class | Orthographic |
| Orthographic Map Projection. More... | |
| class | OsirisRexDistortionMap |
| Distort/undistort focal plane coordinates for OSIRIS REx's cameras. More... | |
| class | OsirisRexOcamsCamera |
| This class models the behavior and attributes of the OSIRIS-REx Cameras: Mapping Camera, PolyMath Camera, and Sample Camera. More... | |
| class | OsirisRexOcamsDistortionMap |
| Distort/undistort focal plane coordinates for OSIRIS REx's cameras. More... | |
| class | OsirisRexOcamsOpenCVDistortionMap |
| OsirisRexOcamsOpenCVDistortionMap camera distortion model for TAGCAMS. More... | |
| class | OsirisRexTagcamsCamera |
| This class models the behavior and attributes of the OSIRIS-REx Navigation cameras: NavCam, NFTCam, and StowCam. More... | |
| class | OsirisRexTagcamsDistortionMap |
| OsirisRexTagcamsDistortionMap camera distortion model for TAGCAMS. More... | |
| class | OverlapNormalization |
| Calculate the bases and multipliers for normalizing overlapping "data sets" (e.g., cubes). More... | |
| class | OverlapStatistics |
| Calculates statistics in the area of overlap between two projected cubes. More... | |
| class | PaletteWindow |
| class | PanTool |
| class | ParameterFx |
| This class is used to bind function names with corresponding Calculator functions that take a parameter. More... | |
| class | PFPixelMapper |
| class | PhotometricFunction |
| An abstract implementation of the photometric function. More... | |
| class | Photometry |
| class | PhotoModel |
| class | PhotoModelFactory |
| This class is used to create PhotoModel objects. More... | |
| class | Pipeline |
| This class helps to call other Isis Applications in a Pipeline. More... | |
| class | PipelineApplication |
| This class represents one application in the pipeline. More... | |
| class | PipelineParameter |
| This class represents a parameter of some type for the PipelineApplication. More... | |
| class | Pixel |
| Store and/or manipulate pixel values. More... | |
| class | PixelFOV |
| This class defines a field of view. More... | |
| class | Planar |
| Planar Map Projection. More... | |
| class | PlaneShape |
| Define plane shape model. More... | |
| class | PlotCurve |
| class | PlotWindow |
| class | PlotWindowBestFitDialog |
| class | Plugin |
| Loads plugins from a shared library. More... | |
| class | PointEditLockedFilter |
| Allows filtering by a control point's edit lock status. More... | |
| struct | PointerCopy |
| Pointer to object policy for copying map elements. More... | |
| struct | PointerRemoval |
| Supplies a policy for deleting pointers that CollectorMap owns. More... | |
| class | PointGeometry |
| Container for a point and its geometry. More... | |
| class | PointIdFilter |
| Filter by control point id string. More... | |
| class | PointIgnoredFilter |
| Allows filtering by a control point's ignored status. More... | |
| class | PointJigsawRejectedFilter |
| Allows filtering by a control point's jigsaw rejected status. More... | |
| class | PointLeafItem |
| A leaf node in the tree structure that represents a control point. More... | |
| class | PointMeasureFilterSelector |
| Allows users to choose filters for filtering points and measures. More... | |
| class | PointMeasureTreeModel |
| Tree model for control points and control measures. More... | |
| class | PointPair |
| Define a point set of left, right and geometry at that location. More... | |
| class | PointParentItem |
| Tree item that is a parent and represents a control point. More... | |
| class | PointPerspective |
| PointPerspective Map Projection. More... | |
| class | PointTableDelegate |
| Delegate for creating, reading, and saving data in the point table. More... | |
| class | PointTableModel |
| Table model for control points. More... | |
| class | PointTypeFilter |
| Filters by point type. More... | |
| class | PolarStereographic |
| Stereographic Map Projection for Polar Aspect. More... | |
| class | PolygonSeeder |
| This class is used as the base class for all PolygonSeeder objects. More... | |
| class | PolygonSeederFactory |
| This class is used to create PolygonSeeder objects. More... | |
| class | PolygonTools |
| Provides various tools to work with geos multipolygons. More... | |
| class | PolynomialBivariate |
| Nth degree Polynomial with two variables. More... | |
| class | PolynomialUnivariate |
| Nth degree Polynomial with one variable. More... | |
| class | Portal |
| Buffer for containing a two dimensional section of an image. More... | |
| class | PrincipalComponentAnalysis |
| Principal Component Analysis class. More... | |
| class | Process |
| Base class for all cube processing derivatives. More... | |
| class | ProcessByBoxcar |
| Process cubes by boxcar. More... | |
| class | ProcessByBrick |
| Process cubes by brick. More... | |
| class | ProcessByLine |
| Process cubes by line. More... | |
| class | ProcessByQuickFilter |
| Process cubes using a Filter Object. More... | |
| class | ProcessBySample |
| Process cubes by sample. More... | |
| class | ProcessBySpectra |
| Process cubes by spectra. More... | |
| class | ProcessByTile |
| Process cubes by tile. More... | |
| class | ProcessExport |
| Process class for exporting cubes. More... | |
| class | ProcessExportPds |
| Process class for exporting cubes to PDS standards. More... | |
| class | ProcessExportPds4 |
| Process class for exporting cubes to PDS4 standards. More... | |
| class | ProcessGroundPolygons |
| Process cube polygons to map or camera projections. More... | |
| class | ProcessImport |
| Byte swapper. More... | |
| class | ProcessImportFits |
| Import a FITS file. More... | |
| class | ProcessImportPds |
| Convert PDS archive files to Isis format. More... | |
| class | ProcessImportVicar |
| Import a Vicar file. More... | |
| class | ProcessMapMosaic |
| Mosaic two cubs together. More... | |
| class | ProcessMosaic |
| Mosaic two cubes together. More... | |
| class | ProcessPolygons |
| class | ProcessRubberSheet |
| Derivative of Process, designed for geometric transformations. More... | |
| class | ProgramLauncher |
| Execute External Programs and Commands. More... | |
| class | Progress |
| Program progress reporter. More... | |
| class | ProgressBar |
| class | Project |
| The main project for ipce. More... | |
| class | Projection |
| Base class for Map Projections. More... | |
| class | ProjectionConfigDialog |
| This is the configuration dialog for the MosaicSceneWidget's projection parameters (map file). More... | |
| class | ProjectionFactory |
| Initialize a map projection. More... | |
| class | ProjectItem |
| Represents an item of a ProjectItemModel in Qt's model-view framework. More... | |
| class | ProjectItemModel |
| Provides access to data stored in a Project through Qt's model-view framework. More... | |
| class | ProjectItemProxyModel |
| Allows access to items in a ProjectItemModel through a proxy model. More... | |
| class | ProjectItemTreeView |
| A ProjectItemTreeView displays items from a ProjectItemProxyModel in a tree structure. More... | |
| class | ProjectItemViewMenu |
| QMenu subclass that overrides the closeEvent. More... | |
| class | PushFrameCamera |
| Generic class for Push Frame Cameras. More... | |
| class | PushFrameCameraCcdLayout |
| Provide image coordinates that map to the push frame detector. More... | |
| class | PushFrameCameraDetectorMap |
| Convert between parent image coordinates and detector coordinates. More... | |
| class | PushFrameCameraGroundMap |
| Convert between undistorted focal plane and ground coordinates. More... | |
| class | PvlConstraints |
| This class can be used to define import/export behavior of Pvl structures when used in the PvlFlatMap class. More... | |
| class | PvlEditDialog |
| PvlEditDialog creates a QDialog window in which a QTextEdit box displays the contents of a pvl file. More... | |
| class | PvlFlatMap |
| Provides a flat map of PvlKeywords. More... | |
| class | PvlToPvlTranslationManager |
| Allows applications to translate simple text files. More... | |
| class | PvlToXmlTranslationManager |
| Allows applications to translate simple text files. More... | |
| class | PvlTranslationTable |
| Internalizes a translation table. More... | |
| class | QHistogram |
| Plot Histograms. More... | |
| class | QIsisApplication |
| Handles exceptions which the QT event handlers and QApplication do not handle. More... | |
| class | QnetCubeDistanceFilter |
| Defines the Distance filter for the QnetNavTool's Cubes section. More... | |
| class | QnetCubeNameFilter |
| Defines the Name filter for the QnetNavTool's Cubes section. More... | |
| class | QnetCubePointsFilter |
| Defines the Points filter for the QnetNavTool's Cubes section. More... | |
| class | QnetFileTool |
| Qnet File operations. More... | |
| class | QnetFilter |
| class | QnetFixedPointDialog |
| class | QnetNavTool |
| Qnet Navigation Tool. More... | |
| class | QnetNewMeasureDialog |
| class | QnetPointCubeNameFilter |
| Defines the Cube Name filter for the QnetNavTool's Points section. More... | |
| class | QnetPointDistanceFilter |
| Defines the Distance filter for the QnetNavTool's Points section. More... | |
| class | QnetPointGoodnessFilter |
| Defines the Goodness of Fit filter for the QnetNavTool's Points section. More... | |
| class | QnetPointIdFilter |
| Defines the Point ID filter for the QnetNavTool's Points section. More... | |
| class | QnetPointImagesFilter |
| Defines the Images filter for the QnetNavTool's Points section, i.e. More... | |
| class | QnetPointJigsawErrorFilter |
| Defines the Jigsaw Error filter for the QnetNavTool's Points section. More... | |
| class | QnetPointMeasureFilter |
| Defines the Measure Properties filter for the QnetNavTool's Points section. More... | |
| class | QnetPointRangeFilter |
| Defines the Range filter for the QnetNavTool's Points section. More... | |
| class | QnetPointRegistrationErrorFilter |
| Defines the Registration Error filter for the QnetNavTool's Points section. More... | |
| class | QnetPointTypeFilter |
| Filter for control point type. More... | |
| class | QnetSetAprioriDialog |
| class | QnetTool |
| Qnet tool operations. More... | |
| class | QStretch |
| Abstract class for complex stretch objects. More... | |
| class | QtExporter |
| Exports cubes into one of several formats with Qt facilities. More... | |
| class | QtImporter |
| Imports a series of standard image formats with Qt facilities. More... | |
| class | Quaternion |
| Provide operations for quaternion arithmetic. More... | |
| class | QuickFilter |
| Container for boxcar statistics. More... | |
| class | RadarCamera |
| Generic class for Radar Cameras. More... | |
| class | RadarGroundMap |
| Convert between undistorted focal plane coordinate (slant range) and ground coordinates. More... | |
| class | RadarGroundRangeMap |
| Construct a mapping between image sample and Radar ground range. More... | |
| class | RadarPulseMap |
| Convert between alpha image coordinates and radar sample, time coordinates. More... | |
| class | RadarSkyMap |
| Convert between slantrange/groundrange and ra/dec coordinates. More... | |
| class | RadarSlantRangeMap |
| Convert between radar ground range and slant range. More... | |
| class | RadialDistortionMap |
| class | Radiometric |
| Store for radiometric gain and shift parameters. More... | |
| class | RawCubeChunk |
| A section of raw data on the disk. More... | |
| struct | RayHitInformation |
| Container that holds the body fixed intersection point and unit surface normal for a hit. More... | |
| class | Reduce |
| Reduce the pixel dimensions of an image. More... | |
| class | RegionalCachingAlgorithm |
| This algorithm recommends chunks to be freed that are not within the last IO. More... | |
| class | RemoveImagesWorkOrder |
| Removes selected images from current project. More... | |
| class | RenameProjectWorkOrder |
| Change the project's GUI name. More... | |
| class | ReseauDistortionMap |
| Distort/undistort focal plane coordinates. More... | |
| class | ResidualMagnitudeFilter |
| Filters by residual magnitude. More... | |
| class | Resource |
| This class provides a resource of PVL keywords for Strategy classes. More... | |
| class | RingCylindrical |
| Ring Cylindrical Map Projection. More... | |
| class | RingPlaneProjection |
| Base class for Map Projections of plane shapes. More... | |
| class | Robinson |
| Robinson Map Projection. More... | |
| struct | RobustFloatCompare |
| Provides a robust comparison of double/float values. More... | |
| class | RollingShutterCamera |
| Generic class for Rolling Shutter Cameras. More... | |
| class | RollingShutterCameraDetectorMap |
| Convert between parent image coordinates and detector coordinates. More... | |
| class | RootItem |
| The root of a tree. More... | |
| class | RosettaOsirisCamera |
| This is the camera model for the Osiris NAC Framing Camera. More... | |
| class | RosettaOsirisCameraDistortionMap |
| Distortion map for converting between undistorted focal plane and distorted focal plane coordinates for the Rosetta OSIRIS NAC and WAC. More... | |
| class | RosettaVirtisCamera |
| Camera model for both Rosetta VIRTIS-M instruments. More... | |
| struct | RTCMultiHitRay |
| Struct for capturing multiple intersections when using embree::rtcintersectscene. More... | |
| struct | RTCOcclusionRay |
| Struct for capturing occluded plates when using embree::rtcintersectscene. More... | |
| class | RubberBandComboBox |
| Combo box for choosing a rubber band type. More... | |
| class | RubberBandTool |
| Rubber banding tool. More... | |
| class | SampleFilter |
| Allows filtering by a control measure's sample. More... | |
| class | SampleManager |
| Buffer manager, for moving through a cube in samples. More... | |
| class | SampleResidualFilter |
| Allows filtering by the sample residual. More... | |
| class | SampleShiftFilter |
| Allows filtering by a control measure's sample shift. More... | |
| class | SaveAsDialog |
| Widget to save(Save As) Isis cubes(used in qview) to display the FileDialog to select the output cube. More... | |
| class | SaveProjectAsWorkOrder |
| Saves a project to disk (File->Save Project As...). More... | |
| class | SaveProjectWorkOrder |
| Saves a project to disk (File->Save Project...). More... | |
| class | SawtoothStretchType |
| This handles the advanced sawtooth stretch. More... | |
| class | ScatterPlotAlarmConfigDialog |
| This is the configuration dialog for alarming scatter plots between the plot window and cube viewports. More... | |
| class | ScatterPlotConfigDialog |
| This configuration dialog is for users to determine the scatter plot parameters required to create a scatter plot. More... | |
| class | ScatterPlotData |
| This is the QwtRasterData for a scatter plot. More... | |
| class | ScatterPlotTool |
| Scatter Plot Tool. More... | |
| class | ScatterPlotWindow |
| Scatter Plot Window. More... | |
| class | Selection |
| Pure Virtual Parent Class for all Selection classes. More... | |
| class | Sensor |
| Class for computing sensor ground coordinates. More... | |
| class | SensorGetInfoWorkOrder |
| This is a child of class WorkOrder which is used for anything that performs an action in a Project. More... | |
| class | SensorInfoWidget |
| Widget for displaying information about a sensor. More... | |
| class | SerialNumber |
| Serial Number composer. More... | |
| class | SerialNumberList |
| Serial Number list generator. More... | |
| class | SessionLog |
| class | SetActiveControlWorkOrder |
| This is a child of class WorkOrder which is used for anything that performs an action in a Project. More... | |
| class | SetActiveImageListWorkOrder |
| This is a child of class WorkOrder which is used for anything that performs an action in a Project. More... | |
| class | Shade |
| class | ShadeAtm |
| class | ShadowCamCamera |
| KPLO ShadowCam Camera Model. More... | |
| class | ShadowCamDistortionMap |
| Distort/undistort focal plane coordinates. More... | |
| class | Shape |
| This represents a shape in a project-based GUI interface. More... | |
| class | ShapeDisplayProperties |
| This is the GUI communication mechanism for shape objects. More... | |
| class | ShapeList |
| Internalizes a list of shapes and allows for operations on the entire list. More... | |
| class | ShapeModel |
| Define shapes and provide utilities for Isis targets. More... | |
| class | ShapeModelFactory |
| This class is used to create ShapeModel objects. More... | |
| class | ShapeReader |
| struct | SimpleCompare |
| Provides a simple comparison between two values. More... | |
| class | SimpleCylindrical |
| Simple Cylindrical Map Projection. More... | |
| class | Sinusoidal |
| Sinusoidal Map Projection. More... | |
| class | SmtkMatcher |
| Workhorse of stereo matcher. More... | |
| class | SmtkPoint |
| Container for SMTK match points. More... | |
| class | SocketThread |
| class | SortFilterProxyModel |
| class | SpacecraftPosition |
| Provides swap observer/target and improved light time correction. More... | |
| class | SparseBlockColumnMatrix |
| SparseBlockColumnMatrix. More... | |
| class | SparseBlockMatrix |
| SparseBlockMatrix. More... | |
| class | SparseBlockRowMatrix |
| SparseBlockRowMatrix. More... | |
| class | SpatialPlotTool |
| Spatial Plots. More... | |
| class | SpecialPixelTool |
| Sets the colors for the special pixel values. More... | |
| class | Spectel |
| Stores information about a "Spectral pixel" or spectel. More... | |
| class | SpectralDefinition |
| contains calibration info for spectral smile correction (center wavelengths and widths for the whole nxn chip) More... | |
| class | SpectralDefinition1D |
| A Spectral definition that includes wavelength and center values for each (line, sample) coordinate. More... | |
| class | SpectralDefinition2D |
| A Spectral definition that includes wavelength and center values for each (line, sample) coordinate. More... | |
| class | SpectralDefinitionFactory |
| Constructs a 2D or 1D spectral definition based on the file name extension. More... | |
| class | SpectralPlotTool |
| Plot cube DN statistics against the cube band numbers. More... | |
| class | SpectralPlotWindow |
| class | Spice |
| Obtain SPICE information for a spacecraft. More... | |
| class | SpicePosition |
| Obtain SPICE position information for a body. More... | |
| class | SpiceRotation |
| Obtain SPICE rotation information for a body. More... | |
| class | SplineFill |
| Compute a low pass filter from a Module class content. More... | |
| class | SqlQuery |
| Construct and execute a query on a database and manage result. More... | |
| class | SqlRecord |
| Provide simplified access to resulting SQL query row. More... | |
| class | SsiCamera |
| This is the camera model for the Galileo Solid State Imaging Camera. More... | |
| class | StandardDeviationOperator |
| Standard deviation interest operator. More... | |
| class | StatCumProbDistDynCalc |
| This class is used to approximate cumulative probibility distributions of a stream of observations without storing the observations or having any apriori knowlege of the range of the data. More... | |
| class | Statistics |
| This class is used to accumulate statistics on double arrays. More... | |
| class | StatisticsTool |
| class | Stereo |
| Provide stereo information/data for a point or relationship. More... | |
| class | StereoTool |
| Tool for computing parallax. More... | |
| class | Strategy |
| Strategy - Supports algorithm development. More... | |
| class | StreamExporter |
| Exports cubes into a standard format in incremental pieces. More... | |
| class | Stretch |
| Pixel value mapper. More... | |
| class | StretchTool |
| Stretch image edit tool. More... | |
| class | StretchType |
| This is the base class for advanced stretches. More... | |
| class | StripPolygonSeeder |
| Seed points using a grid with a staggered pattern. More... | |
| class | SubArea |
| Apply corrections to a cube label for subarea extraction. More... | |
| class | SubTreeProxyModel |
| class | SunShadowTool |
| Tool for measuring shadow heights. More... | |
| class | SurfaceModel |
| Model a 3-D surface. More... | |
| class | SurfacePoint |
| This class defines a body-fixed surface point. More... | |
| class | Tab |
| A Tab is a QAction which shows or hides some other QWidget, which we call associatedWidget. More... | |
| class | TabBar |
| A TabBar is a QToolBar which is specifically designed to store and manage Tabs, which are specialized QToolButtons that can hide and show other QWidgets (see Tab). More... | |
| class | TableColumn |
| class | TableColumnList |
| class | TableMainWindow |
| a subclass of the qisis mainwindow, tablemainwindow handles all of the table tasks. More... | |
| class | TableView |
| class | TableViewContent |
| class | TableViewHeader |
| class | Target |
| This class is used to create and store valid Isis targets. More... | |
| class | TargetBody |
| Container class for TargetBody. More... | |
| class | TargetBodyDisplayProperties |
| This is the GUI communication mechanism for target body objects. More... | |
| class | TargetBodyList |
| List for holding TargetBodies. More... | |
| class | TargetGetInfoWorkOrder |
| This work order allows the user to view target body info. More... | |
| class | TargetInfoWidget |
| Widget for displaying information about a target. More... | |
| class | TaylorCameraDistortionMap |
| Distort/undistort focal plane coordinates. More... | |
| class | Template |
| class | TemplateEditorWidget |
| Widget for displaying information about a target. More... | |
| class | TemplateEditViewWorkOrder |
| This work order allows the user to view and edit a template. More... | |
| class | TemplateList |
| class | TextFile |
| Provides access to sequential ASCII stream I/O. More... | |
| class | TgoCassisCamera |
| TGO Cassis camera model. More... | |
| class | TgoCassisDistortionMap |
| Distort/undistort focal plane coordinates. More... | |
| class | ThemisIrCamera |
| THEMIS IR Camera. More... | |
| class | ThemisIrDistortionMap |
| Distort/undistort focal plane coordinates. More... | |
| class | ThemisVisCamera |
| THEMIS VIS Camera Model. More... | |
| class | ThemisVisDistortionMap |
| Distort/undistort focal plane coordinates. More... | |
| class | Threshold |
| Compute/test the Affine convergence from given parameters/chip. More... | |
| class | TiffExporter |
| Exports cubes into TIFF images. More... | |
| class | TiffImporter |
| Imports TIFF images as Isis cubes. More... | |
| class | TileManager |
| Buffer manager, for moving through a cube in tiles. More... | |
| class | Tool |
| Base class for the Qisis tools. More... | |
| class | ToolList |
| Allows tools to share data between each other. More... | |
| class | ToolPad |
| class | Topo |
| Topographic derivative of an arbitrary photometric function. More... | |
| class | TopoAtm |
| As in the case without an atmosphere, processing proceeds in three steps, a pass 1 PHOTOM followed by a divide filter to is- olate topography from albedo variations followed by a pass 2 PHOTOM. More... | |
| class | TProjection |
| Base class for Map TProjections. More... | |
| class | TrackingTable |
| Table to store tracking information for a mosaic. More... | |
| class | TrackTool |
| This tool is part of the Qisis namespace and displays the statusbar of the window. More... | |
| class | Transform |
| Pixel transformation. More... | |
| class | TransverseMercator |
| TransverseMercator Map Projection. More... | |
| class | TreeView |
| class | TreeViewContent |
| class | TreeViewHeader |
| class | TriangularPlate |
| Specification for an abstract triangular plate. More... | |
| class | UniqueIOCachingAlgorithm |
| This algorithm is designed for applications that jump around between a couple of spots in the cube with a difficult to predict pattern but always the same places in the cube. More... | |
| class | UniversalGroundMap |
| Universal Ground Map. More... | |
| class | UpturnedEllipsoidTransverseAzimuthal |
| Upturned Ellipsoid Transverse Azimuthal Map Projection. More... | |
| class | UserInterface |
| Command Line and Xml loader, validation, and access. More... | |
| class | UvvisCamera |
| This is the camera model for the Clementine Ultraviolet/Visible Camera. More... | |
| class | VariableLineScanCameraDetectorMap |
| Convert between parent image coordinates and detector coordinates. More... | |
| class | VecFilter |
| This class is used to perform filter operations on vectors. More... | |
| class | ViewControlNet3DWorkOrder |
| This work order displays a control network in 3D in an OpenGL view. More... | |
| class | ViewportBuffer |
| Reads and stores visible DN values. More... | |
| class | ViewportBufferAction |
| class | ViewportBufferFill |
| class | ViewportBufferStretch |
| class | ViewportBufferTransform |
| class | ViewportMainWindow |
| This was called the Qisis MainWindow. More... | |
| class | ViewportMdiSubWindow |
| This is an actual viewport window in qview/qnet/etc. More... | |
| class | ViewSubWindow |
| This class exists to contain detached views from ipce. More... | |
| class | VikingCamera |
| Viking Camera Model. More... | |
| class | VimsCamera |
| Cassini Vims camera model. More... | |
| class | VimsGroundMap |
| Convert between undistorted focal plane and ground coordinates. More... | |
| class | VimsSkyMap |
| Convert between undistorted focal plane and ground coordinates. More... | |
| class | VisualDisplay |
| Tool to visualize statistics in an n * m box. More... | |
| class | VoidFx |
| This class is used to bind function names with corresponding Calculator functions that do not take parameters. More... | |
| class | VoyagerCamera |
| Voyager Camera Model. More... | |
| class | WarningTreeWidget |
| Warning Widget for ipce. More... | |
| class | WarningWidget |
| Displays the NoWarning icon as default and the Warning icon in case of exception and also pops up a a menu when an exception occurs. More... | |
| class | WindowTool |
| class | WorkOrder |
| Provide Undo/redo abilities, serialization, and history for an operation. More... | |
| class | WorkOrderFactory |
| Instantiate work orders from QString versions of the class name. More... | |
| class | Workspace |
| class | WorldMapper |
| Create a mapping between a projection and other coordinate system. More... | |
| class | XmlToPvlTranslationManager |
| Allows applications to translate Xml label files. More... | |
| class | ZeroBufferFit |
| Computes non-linear lsq fit of HiRISE Drift (Zd module). More... | |
| class | ZeroBufferSmooth |
| Processes Buffer calibration data (ZeroBufferSmooth Module). More... | |
| class | ZeroDark |
| Computes a complex dark subtraction component (ZeroDark module). More... | |
| class | ZeroDarkRate |
| Computes a complex dark subtraction component (ZeroDarkRate module). More... | |
| class | ZeroReverse |
| Processes Reverse Clock calibration data (ZeroReverse Module). More... | |
| class | ZoomTool |
| Handles zoom operations for Isis qt apps. More... | |
Enumerations | |
| enum | { NCONSTR = 8 } |
| enum | FindFocalPlaneStatus { Success , BoundingProblem , Failure } |
| Convert between undistorted focal plane and ground coordinates. More... | |
Functions | |
| Angle | operator* (double mult, Angle angle) |
| Multiply this angle by a double and return the resulting angle. | |
| int | bt_MaxBodyParts () |
| Maximum number of parts/object. | |
| unsigned long | bt_MaxTriangles () |
| Maximum number of triangles/part. | |
| int | b3_MaxBodyParts () |
| Maximum number of parts/object in the Bullet 3 API. | |
| unsigned long | b3_MaxTriangles () |
| Maximum number of triangles/part in the Bullet 3 API. | |
| double | NegateOperator (double a) |
| Returns the nagative of the input parameter. | |
| double | MultiplyOperator (double a, double b) |
| Returns the result of a multiplied by b. | |
| double | DivideOperator (double a, double b) |
| Returns the result of dividing a by b. | |
| double | AddOperator (double a, double b) |
| Returns the result of additing a with b. | |
| double | SubtractOperator (double a, double b) |
| Returns the result of subtracting b from a. | |
| double | GreaterThanOperator (double a, double b) |
| Returns 1.0 if a is greater than b. | |
| double | LessThanOperator (double a, double b) |
| Returns 1.0 if a is less than b. | |
| double | EqualOperator (double a, double b) |
| Returns 1.0 if a is equal ot b. | |
| double | GreaterThanOrEqualOperator (double a, double b) |
| Returns 1.0 if a is greater than or equal to b. | |
| double | LessThanOrEqualOperator (double a, double b) |
| Returns 1.0 if a is less than or eqaul to b. | |
| double | NotEqualOperator (double a, double b) |
| Returns 1.0 is a is not equal to b. | |
| double | CosecantOperator (double a) |
| Returns the cosecant of the input a. | |
| double | SecantOperator (double a) |
| Returns the secant of the input a. | |
| double | CotangentOperator (double a) |
| Returns the cotangent of the input a. | |
| int | Round (double a) |
| Returns the result of rounding the input a to the closest integer. | |
| double | BitwiseAndOperator (double a, double b) |
| Returns the result of a bitwise AND accross a and b. | |
| double | BitwiseOrOperator (double a, double b) |
| Returns the result of a bitwise OR across a and b. | |
| double | ModulusOperator (double a, double b) |
| Returns the modulus of a by b. | |
| double | MaximumOperator (double a, double b) |
| Returns the max of a and b. | |
| double | MinimumOperator (double a, double b) |
| Returns the min of a and b. | |
| json | stateAsJson (std::string modelState) |
| void | sanitize (std::string &input) |
| std::istream & | operator>> (std::istream &is, CSVReader &csv) |
| Input read operator for input stream sources. | |
| QString | LabelAttachmentName (Cube::LabelAttachment labelType) |
| Return the string representation of the contents of a variable of type LabelAttachment. | |
| Cube::LabelAttachment | LabelAttachmentEnumeration (const QString &labelType) |
| Return the appropriate LabelType depending on which of the valid values the argument spells. | |
| Displacement | operator* (double mult, Displacement displacement) |
| Multiply displacement by a value (5m * 2 = 10m). | |
| Distance | operator* (double mult, Distance dist) |
| Multiply this distance by a value (5m * 2 = 10m). | |
| json | fitsToJson (std::ifstream &fileStream) |
| Convert the contents of a stream to a JSON object. | |
| json | fitsToJson (FileName fitsFile) |
| Converts a FITS file to a json object. | |
| Coordinate | operator+ (const Coordinate &A, const Coordinate &B) |
| Summation operator for Coordinate. | |
| Coordinate | operator- (const Coordinate &A, const Coordinate &B) |
| Subtraction operator for Coordinate. | |
| Radiometric | operator+ (const Radiometric &A, const Radiometric &B) |
| Operator to sum two radiometric parameters. | |
| QDebug | operator<< (QDebug debug, const Hillshade &hillshade) |
| Print this class out to a QDebug object. | |
| double | floatModulusOperator (double a, double b) |
| Determines the remainder of the quotient a/b whose sign is the same as that of a. | |
| Isis::TProjection * | IProjPlugin (Isis::Pvl &lab, bool allowDefaults) |
| This is the function that is called in order to instantiate a Sinusoidal object. | |
| iTime | operator+ (const double &secondsToAdd, iTime time) |
| iTime | operator- (const double &secondsToSubtract, iTime time) |
| QDebug | operator<< (QDebug dbg, const LinearAlgebra::Vector &vector) |
| A global function to format a LinearAlgebra::Vector as a QString and writes it to a QDebug stream. | |
| QDebug | operator<< (QDebug dbg, const LinearAlgebra::Matrix &matrix) |
| A global function to format a LinearAlgebra::Matrix as a QString and write it to a QDebug stream. | |
| QString | toString (const LinearAlgebra::Vector &vector, int precision) |
| A global function to format LinearAlgebra::Vector as a QString with the given precision. | |
| void | computeBestFitProjectiveTransform (std::vector< std::vector< double > > const &imagePts, std::vector< std::vector< double > > const &groundPts, std::vector< double > &transformCoeffs) |
| ostream & | operator<< (ostream &os, Matrix &matrix) |
| Write the matrix to the output stream. | |
| std::ostream & | operator<< (std::ostream &os, Matrix &matrix) |
| bool | validate (const NaifVertex &v) |
| Verifies that the given NaifVector or NaifVertex is 3 dimensional. | |
| bool | validate (const NaifTriangle &t) |
| Verifies that the given NaifTriangle is 3 x 3. | |
| QDebug | operator<< (QDebug dbg, const TNT::Array1D< SpiceDouble > &tntArray) |
| Enables any TNT array of SpiceDoubles to be passed into qDebug() directly. | |
| QDebug | operator<< (QDebug dbg, const TNT::Array2D< SpiceDouble > &tntMatrix) |
| Enables any 2 dimensional TNT array of SpiceDoubles to be passed into qDebug() directly. | |
| QString | toString (const TNT::Array1D< SpiceDouble > &naifArray, int precision) |
| Formats any TNT array of SpiceDoubles as a string with given precision. | |
| std::ostream & | operator<< (std::ostream &os, Isis::OverlapStatistics &stats) |
| Creates a pvl of various useful data obtained by the overlap statistics class. | |
| ostream & | operator<< (ostream &os, Pipeline &pipeline) |
| This is the output operator for a Pipeline, which enables things such as: | |
| json | pvlKeywordToJSON (PvlKeyword &keyword) |
| Convert the contents of a PvlKeyword to a JSON object. | |
| json | pvlContainerToJSON (PvlContainer &container) |
| Convert the contents of a PvlContainer to a JSON object. | |
| json | pvlGroupToJSON (PvlGroup &group) |
| Convert the contents of a PvlGroup to a JSON object. | |
| json | pvlObjectToJSON (PvlObject &object) |
| Convert the contents of a PvlObject to a JSON object. | |
| json | pvlToJSON (Pvl &pvl) |
| Convert the contents of a Pvl to a JSON object. | |
| json | pvlToJSON (QString pvlFile) |
| Converts an PVL file to a json object. | |
| int | choleski_solve (double *a, double *b, int nsize, int flag) |
| int | inverse (double *a, int nsize) |
| int | isymp (int row, int col) |
| int | indeces_from_set (int *indeces, int set, int set_size, int n) |
| int | binomial_coeficient (int n, int k) |
| int | decompose (double *, int) |
| int | foresub (double *, double *, int) |
| int | backsub (double *, double *, int) |
| std::ostream & | operator<< (std::ostream &os, Isis::SessionLog &log) |
| QDataStream & | operator<< (QDataStream &stream, const SparseBlockColumnMatrix &sbcm) |
| Writes matrix to binary disk file pointed to by QDataStream stream. | |
| QDataStream & | operator>> (QDataStream &stream, SparseBlockColumnMatrix &sbcm) |
| Reads matrix from binary disk file pointed to by QDataStream stream. | |
| QDebug | operator<< (QDebug dbg, const SparseBlockColumnMatrix &sbcm) |
| Writes matrix to QDebug stream. | |
| QDataStream & | operator<< (QDataStream &stream, const SparseBlockRowMatrix &sbrm) |
| Writes matrix to binary disk file pointed to by QDataStream stream. | |
| QDataStream & | operator>> (QDataStream &stream, SparseBlockRowMatrix &sbrm) |
| Reads matrix from binary disk file pointed to by QDataStream stream. | |
| QDebug | operator<< (QDebug dbg, const SparseBlockRowMatrix &sbrm) |
| Writes matrix to QDebug stream. | |
| QDataStream & | operator<< (QDataStream &stream, const SparseBlockMatrix &sparseBlockMatrix) |
| Writes matrix to binary disk file pointed to by QDataStream stream. | |
| QDataStream & | operator>> (QDataStream &stream, SparseBlockMatrix &sparseBlockMatrix) |
| Reads matrix from binary disk file pointed to by QDataStream stream. | |
| QDebug | operator<< (QDebug dbg, const SparseBlockMatrix &m) |
| Writes matrix to QDebug stream. | |
| QDataStream & | operator<< (QDataStream &stream, const StatCumProbDistDynCalc &scpddc) |
| QDataStream & | operator>> (QDataStream &stream, StatCumProbDistDynCalc &scpddc) |
| QDataStream & | operator<< (QDataStream &stream, const Statistics &statistics) |
| QDataStream & | operator>> (QDataStream &stream, Statistics &statistics) |
| json | convertLastChildNodeToJson (QDomElement &element) |
| Not intended to be used directly. | |
| json | convertXmlToJson (QDomElement &element, json &output) |
| Not intended to be used directly. | |
| json | xmlToJson (QString xmlFile) |
| Converts an XML file to a json object. | |
| json | xmlToJson (QDomDocument &doc) |
| Converts an XML document stored in a QDomDocument into a JSON object. | |
| static void | cholmodErrorHandler (int nStatus, const char *file, int nLineNo, const char *message) |
| Custom error handler for CHOLMOD. | |
| void | setStringAttribute (int locationId, QString locationName, QString attributeName, QString attributeValue) |
| QString | getStringAttribute (int locationId, QString locationName, QString attributeName) |
| QDataStream & | operator<< (QDataStream &stream, const MaximumLikelihoodWFunctions &mlwf) |
| QDataStream & | operator>> (QDataStream &stream, MaximumLikelihoodWFunctions &mlwf) |
| QDataStream & | operator<< (QDataStream &stream, const MaximumLikelihoodWFunctions::Model &modelEnum) |
| QDataStream & | operator>> (QDataStream &stream, MaximumLikelihoodWFunctions::Model &modelEnum) |
| int | ValidCount (const HiVector &v) |
| Counts number of valid pixels in vector. | |
| int | InValidCount (const HiVector &v) |
| Counts number of invalid pixels in vector. | |
| int | CpmmToCcd (int cpmm) |
| Convert HiRISE Cpmm number to Ccd number. | |
| QString | CcdToFilter (int ccd) |
| Convert HiRISE Ccd number to string filter name. | |
| HiMatrix | cropLines (const HiMatrix &m, int sline, int eline) |
| Crop specified lines from a buffer. | |
| HiMatrix | cropSamples (const HiMatrix &m, int ssamp, int esamp) |
| Crop specified samples from a buffer. | |
| HiVector | averageLines (const HiMatrix &m, int sline=0, int eline=-1) |
| Reduces by averaging specified lines from a buffer. | |
| HiVector | averageSamples (const HiMatrix &m, int ssamp=0, int esamp=-1) |
| Reduces by averaging specified samples from a buffer. | |
| template<typename T> | |
| T | ConfKey (const DbProfile &conf, const QString &keyname, const T &defval, int index=0) |
| Find a keyword in a profile using default for non-existant keywords. | |
| template<typename T> | |
| int | ToInteger (const T &value) |
| Helper function to convert values to Integers. | |
| template<typename T> | |
| double | ToDouble (const T &value) |
| Helper function to convert values to doubles. | |
| template<typename T> | |
| QString | ToString (const T &value) |
| Helper function to convert values to strings. | |
| bool | IsEqual (const QString &v1, const QString &v2="TRUE") |
| Shortened string equality test. | |
| bool | IsTrueValue (const DbProfile &prof, const QString &key, const QString &value="TRUE") |
| Determines if the keyword value is the expected value. | |
| bool | SkipModule (const DbProfile &prof) |
| Checks profile flag to skip the current Module. | |
| HiMatrix | appendLines (const HiMatrix &top, const HiMatrix &bottom) |
| HiMatrix | appendSamples (const HiMatrix &left, const HiMatrix &right) |
| double | HiTempEqn (const double temperature, const double napcm2=2.0, const double px=12.0) |
| Implements (classic) HiRISE temperature equation. | |
| HiVector | rebin (const HiVector &v, int n) |
| Rebins a vector to a different size. | |
| void | RemoveHiBlobs (Pvl &label) |
| Deletes HiRISE specific BLOBS from cube file. | |
| double | GainLineStat (std::vector< double > &data) |
| Return the statistics for a vector of data. | |
| Kernel::Type | operator| (Kernel::Type a, Kernel::Type b) |
| Logical operator for combining Type flags. | |
Variables | |
| Application * | iApp = NULL |
| static geos::geom::GeometryFactory::Ptr | globalFactory = geos::geom::GeometryFactory::create() |
| const int | SizeMatch = 1 |
| const int | SpatialMatch = 2 |
| const int | OneBand = 16 |
| const int | BandMatchOrOne = 32 |
| const int | ReadWrite = 64 |
| const int | AllMatchOrOne = 128 |
| const QString | trackingTableName = "InputImages" |
| QString | sPointType [] = { "Fixed", "Constrained", "Free" } |
| String names for Point Type. | |
| QString | sBoolean [] = { "False", "True" } |
| String values for Boolean. | |
| static constexpr double | TOLERANCE = 1.0e-10 |
| static constexpr double | OUT_OF_BOUNDS_LIMIT = 40 |
| const int | VIEWSIZE = 301 |
| Constant representing the length and width of the chip viewports. | |
This is free and unencumbered software released into the public domain.
Namespace for all Isis base objects.
Namespace for ISIS/Bullet specific routines.
The authors of ISIS do not claim copyright on the contents of this file. For more details about the LICENSE terms and the AUTHORS, you will find files of those names at the top level of this repository.
The authors of ISIS do not claim copyright on the contents of this file. For more details about the LICENSE terms and the AUTHORS, you will find files of those names at the top level of this repository. Unless noted otherwise, the portions of Isis written by the USGS are public domain. See individual third-party library and package descriptions for intellectual property information, user agreements, and related information.
Although Isis has been used by the USGS, no warranty, expressed or implied, is made by the USGS as to the accuracy and functioning of such software and related material nor shall the fact of distribution constitute any such warranty, and no responsibility is assumed by the USGS in connection therewith.
For additional information, launch $ISISROOT/doc//documents/Disclaimers/Disclaimers.html in a browser or see the Privacy & Disclaimers page on the Isis website, http://isis.astrogeology.usgs.gov, and the USGS privacy and disclaimers on http://www.usgs.gov/privacy.html.
The authors of ISIS do not claim copyright on the contents of this file. For more details about the LICENSE terms and the AUTHORS, you will find files of those names at the top level of this repository.
Generic class for Rolling Shutter Cameras
This class is used to abstract out framing camera functionality from children classes.
The authors of ISIS do not claim copyright on the contents of this file. For more details about the LICENSE terms and the AUTHORS, you will find files of those names at the top level of this repository. This is free and unencumbered software released into the public domain.
The authors of ISIS do not claim copyright on the contents of this file. For more details about the LICENSE terms and the AUTHORS, you will find files of those names at the top level of this repository.
Definition for BundleControlPointQSP, a shared pointer to a BundleControlPoint.
Typdef for BundleLidarRangeConstraint QSharedPointer.
Definition for BundleMeasureQsp, a shared pointer to a BundleMeasure.
Typdef for BundleObservation QSharedPointer.
Definition for BundleObservationSolveSettingsQsp, a QSharedPointer to a BundleObservationSolveSettings object.
| typedef QSharedPointer< BundleSettings > Isis::BundleSettingsQsp |
Definition for a BundleSettingsQsp, a shared pointer to a BundleSettings object.
Definition for BundleTargetBodyQsp, a QSharedPointer to a BundleTargetBody.
| typedef QSharedPointer<ControlNet> Isis::ControlNetQsp |
Typedef for QSharedPointer to control network. This typedef is for future implementation of target body.
| typedef QSharedPointer<FileItem> Isis::FileItemQsp |
A FileItem smart pointer.
| typedef Affine::AMatrix Isis::GMatrix |
| typedef QSharedPointer<GuiCamera> Isis::GuiCameraQsp |
GuiCameraQsp Represents a smart pointer to a GuiCamera object.
It behaves exactly like a normal pointer, but it is thread-safe and it will delete the pointer it is holding when it goes out of scope, provided no other QSharedPointer objects are referencing it.
| typedef TNT::Array1D<double> Isis::GVector |
| typedef TNT::Array2D<double> Isis::HiMatrix |
2-D buffer
| typedef TNT::Array1D<double> Isis::HiVector |
1-D Buffer
Typdef for IsisBundleObservation QSharedPointer.
Definition for a shared pointer to a LidarControlPoint.
| typedef QSharedPointer<LidarData> Isis::LidarDataQsp |
Definition for a shared pointer to a LidarData object.
| typedef TNT::Array2D<SpiceDouble> Isis::NaifTriangle |
3-D triangle[3][3]
| typedef TNT::Array1D<SpiceDouble> Isis::NaifVector |
Namespace to contain type definitions of NAIF DSK fundamentals.
This NAIF DSK utility provides the means to a TIN. Needed are types that define efficient implemenations of vectors, vertices and triangles (plates). The TNT library is used to specify these fundamental types due to its efficeint passing and memory manaegement mechanisms.
| typedef TNT::Array1D<SpiceDouble> Isis::NaifVertex |
1-D Buffer[3]
| typedef QList<SharedResource> Isis::ResourceList |
Defintion of a ResourceList, a list of SharedResource types.
Definition for a SharedGisGeometry, a shared pointer to a GisGeometry.
| typedef QSharedPointer<Resource> Isis::SharedResource |
Defintion of a SharedResource, a shared pointer to a Resource object.
| typedef QSharedPointer<Strategy> Isis::SharedStrategy |
Definition for a SharedStrategy, a shared pointer to a Strategy.
| typedef QPair<int, int> Isis::SmtkQPair |
| typedef QHash<SmtkQPair, SmtkPoint> Isis::SmtkQStack |
| typedef SmtkQStack::const_iterator Isis::SmtkQStackConstIter |
| typedef SmtkQStack::iterator Isis::SmtkQStackIter |
| typedef QList<SharedStrategy> Isis::StrategyList |
Definition for a StrategyList, a list of SharedStrategy types.
| typedef QSharedPointer<TargetBody> Isis::TargetBodyQsp |
Defines A smart pointer to a TargetBody obj.
| typedef QSharedPointer<Target> Isis::TargetQsp |
Convert between undistorted focal plane and ground coordinates.
This class is used to convert between undistorted focal plane coordinates (x/y) in millimeters and ground coordinates lat/lon for line scan cameras.
| Enumerator | |
|---|---|
| Success | |
| BoundingProblem | |
| Failure | |
| double Isis::AddOperator | ( | double | a, |
| double | b ) |
Returns the result of additing a with b.
| a | Input double |
| b | Input double |
Referenced by Isis::Calculator::Add().
Referenced by Isis::HiCalData::getBufferExtended(), and Isis::HiCalData::getDarkExtended().
Reduces by averaging specified lines from a buffer.
This function produces a vector from a 2-D buffer of averaged lines at each vertical sample location
| m | Buffer to reduce |
| sline | Starting line number (first line is 0) |
| eline | Last line to average (-1 means use all lines) |
References Isis::Statistics::AddData(), and Isis::Statistics::Average().
Reduces by averaging specified samples from a buffer.
This function produces a vector from a 2-D buffer of averaged samples at each horizontal line location
| m | Buffer to reduce |
| ssamp | Starting sample number (first sample is 0) |
| esamp | Last sample to average (-1 means use all samples) |
References Isis::Statistics::AddData(), and Isis::Statistics::Average().
|
inline |
Maximum number of parts/object in the Bullet 3 API.
References bt_MaxBodyParts().
|
inline |
Maximum number of triangles/part in the Bullet 3 API.
References bt_MaxTriangles().
|
inline |
References NOT_SOLVABLE, and SOLVED.
Referenced by choleski_solve().
|
inline |
Referenced by indeces_from_set().
| double Isis::BitwiseAndOperator | ( | double | a, |
| double | b ) |
Returns the result of a bitwise AND accross a and b.
| a | Input double |
| b | Input double |
References Round().
Referenced by Isis::Calculator::And().
| double Isis::BitwiseOrOperator | ( | double | a, |
| double | b ) |
Returns the result of a bitwise OR across a and b.
| a | Input double |
| b | INput double |
References Round().
Referenced by Isis::Calculator::Or().
|
inline |
Maximum number of parts/object.
Referenced by b3_MaxBodyParts().
|
inline |
Maximum number of triangles/part.
Referenced by b3_MaxTriangles().
|
inline |
Convert HiRISE Ccd number to string filter name.
| ccd | Ccd number of device |
References toString().
|
inline |
References backsub(), decompose(), foresub(), inverse(), NOT_SOLVABLE, and SOLVED.
Referenced by Isis::Selection::bestFitEllipse(), and Isis::ApolloPanIO::computeInteriorOrienation().
|
static |
Custom error handler for CHOLMOD.
If CHOLMOD encounters an error then this will be called.
| status | The CHOLMOD error status. |
| file | The name of the source code file where the error occured. |
| lineNumber | The line number in file where the error occured. |
| message | The error message. |
References toString().
| void Isis::computeBestFitProjectiveTransform | ( | std::vector< std::vector< double > > const & | imagePts, |
| std::vector< std::vector< double > > const & | groundPts, | ||
| std::vector< double > & | transformCoeffs ) |
| T Isis::ConfKey | ( | const DbProfile & | conf, |
| const QString & | keyname, | ||
| const T & | defval, | ||
| int | index = 0 ) |
Find a keyword in a profile using default for non-existant keywords.
This template function will extract keyword values from a profile and provide the values at the indicated index. If the keyword does not exist or the indicated value at index, the provided default will be used instead.
References Isis::DbProfile::count(), Isis::DbProfile::exists(), and Isis::DbProfile::value().
Referenced by Isis::LoadCSV::load(), and Isis::ZeroBufferFit::ZeroBufferFit().
| json Isis::convertLastChildNodeToJson | ( | QDomElement & | element | ) |
Not intended to be used directly.
Converts a QDomElement to JSON and returns. Only called when a QDomElement has no further child nodes
Used for the following situations:
XML: <tag>value</tag> JSON: {tag: value}
XML: <tag attributeName="attributeValue">textValue</tag> JSON: {tag: {attrib_attributeName: "attributeValue, "_text":textValue } } XML: <tag attributeName="attributeValue" /> JSON: {tag: {attrib_attributeName: "attributeValue"} }
XML: <tag > JSON: tag: null
| element | A QDomElement to be converted to JSON and added to the JSON object. |
Referenced by convertXmlToJson().
Not intended to be used directly.
Intended to be used by xmlToJson to convert an input XML document to JSON.
This function does the following conversions:
XML: val1val2 JSON: a : {b: val1, c: val2}
XML: <first>value1</first> <second>value2</second> JSON: a: [ {first:value1}, {second:value2} ]
XML: val1val2 JSON: a:[val1, val2]
| element | A QDomElement representing the whole or some subset of a QDomDocument |
| output | A JSON object constructed from XML input. |
References convertLastChildNodeToJson(), and convertXmlToJson().
Referenced by convertXmlToJson(), and xmlToJson().
| double Isis::CosecantOperator | ( | double | a | ) |
Returns the cosecant of the input a.
| a | Input double |
Referenced by Isis::Calculator::Cosecant().
| double Isis::CotangentOperator | ( | double | a | ) |
Returns the cotangent of the input a.
| a | Input double |
Referenced by Isis::Calculator::Cotangent().
|
inline |
Crop specified lines from a buffer.
This function extracts lines from a buffer and returns a new buffer with the extracted lines.
| m | Buffer to extract lines from |
| sline | Starting line number (first line is 0) |
| eline | Last line to extract |
Referenced by Isis::HiCalData::getMask(), Isis::HiCalData::getMaskExtended(), Isis::HiCalData::getRamp(), Isis::HiCalData::getRampExtended(), Isis::HiCalData::getReverseClock(), and Isis::HiCalData::getReverseClockExtended().
|
inline |
References NOT_SOLVABLE, and SOLVED.
Referenced by choleski_solve().
| double Isis::DivideOperator | ( | double | a, |
| double | b ) |
Returns the result of dividing a by b.
| a | Input double |
| b | Intput double |
Referenced by Isis::Calculator::Divide().
| double Isis::EqualOperator | ( | double | a, |
| double | b ) |
Returns 1.0 if a is equal ot b.
| a | Input double |
| b | Input double |
Referenced by Isis::Calculator::Equal().
| nlohmann::json Isis::fitsToJson | ( | FileName | fitsFile | ) |
Converts a FITS file to a json object.
| fitsFile | Path to a FITS file. |
References fitsToJson().
| nlohmann::json Isis::fitsToJson | ( | std::ifstream & | fileStream | ) |
Convert the contents of a stream to a JSON object.
| the | stream to convert |
This logic was taken from ProcessImportFits::extractFitsLabels
References pvlObjectToJSON().
Referenced by fitsToJson().
| double Isis::floatModulusOperator | ( | double | a, |
| double | b ) |
Determines the remainder of the quotient a/b whose sign is the same as that of a.
In other words, this method finds the value r = a - bq such that q is the integer found by truncating a/b.
| a | The dividend (numerator). |
| b | The divisor (denominator). |
Referenced by Isis::InlineCalculator::floatModulus().
|
inline |
References NOT_SOLVABLE, and SOLVED.
Referenced by choleski_solve().
|
inline |
Return the statistics for a vector of data.
The default statistic returned is the median of the dataset but can be changed with a compile time change. The vector passed in will be sorted so that the median can be determined. If the vector has an even number of elements in it, the average of the two center values will be returned. The array is assumed to be clean data, no ISIS special pixels.
| data | Vector containing data compute the statistic. It will be altered (sorted) upon return to the caller. |
References Isis::Statistics::AddData().
| QString Isis::getStringAttribute | ( | int | locationId, |
| QString | locationName, | ||
| QString | attributeName ) |
| double Isis::GreaterThanOperator | ( | double | a, |
| double | b ) |
Returns 1.0 if a is greater than b.
Otherwise 0.0 is returned.
| a | Input double |
| b | Input double |
Referenced by Isis::Calculator::GreaterThan().
| double Isis::GreaterThanOrEqualOperator | ( | double | a, |
| double | b ) |
Returns 1.0 if a is greater than or equal to b.
Otherwise 0.0 is returned.
| a | Input double |
| b | Input double |
Referenced by Isis::Calculator::GreaterThanOrEqual().
|
inline |
Implements (classic) HiRISE temperature equation.
This function computes the dark current temperature and returns the results in electrons/sec/pixel.
| temperature | Temperature (typically of the FPGA) |
| napcm2 | Dark current for silicone diodes (nano-ampres/cm^2) |
| px | Pixel size in microns |
|
inline |
References binomial_coeficient().
|
inline |
Counts number of invalid pixels in vector.
| v | Vector to inspect |
|
inline |
References SOLVED.
Referenced by choleski_solve().
| Isis::TProjection * Isis::IProjPlugin | ( | Isis::Pvl & | lab, |
| bool | allowDefaults ) |
This is the function that is called in order to instantiate a Sinusoidal object.
| lab | Cube labels with appropriate Mapping information. |
| allowDefaults | Indicates whether CenterLongitude are allowed to be computed using the middle of the longitude range specified in the labels. |
|
inline |
Shortened string equality test.
| v1 | First value |
| v2 | Second value |
Referenced by IsTrueValue(), Isis::LoadCSV::load(), and Isis::ZeroBufferFit::ZeroBufferFit().
|
inline |
Determines if the keyword value is the expected value.
This function checks the existance of a keyword in a profile, extracts the first value and tests it for equivelance to the expected value. Note this test is case insensitive.
| prof | Profile to find the expected keyword in |
| key | Name of keyword in profile to test |
| value | Value to test for in keyword |
References Isis::DbProfile::exists(), and IsEqual().
Referenced by SkipModule(), and Isis::ZeroBufferFit::ZeroBufferFit().
|
inline |
Referenced by Isis::Selection::bestFitEllipse(), and Isis::ApolloPanIO::computeInteriorOrienation().
|
inline |
Return the appropriate LabelType depending on which of the valid values the argument spells.
| labelType |
References Isis::Cube::AttachedLabel, Isis::Cube::DetachedLabel, Isis::Cube::ExternalLabel, and Isis::Cube::GdalLabel.
|
inline |
Return the string representation of the contents of a variable of type LabelAttachment.
| labelType | The LabelAttachment enum to be converted to a string |
References Isis::Cube::AttachedLabel, Isis::Cube::DetachedLabel, Isis::Cube::ExternalLabel, and Isis::Cube::GdalLabel.
Referenced by Isis::Cube::create(), and Isis::CubeAttributeOutput::setLabelAttachment().
| double Isis::LessThanOperator | ( | double | a, |
| double | b ) |
Returns 1.0 if a is less than b.
Otherwise 0.0 is returned.
| a | Input double |
| b | Input double |
Referenced by Isis::Calculator::LessThan().
| double Isis::LessThanOrEqualOperator | ( | double | a, |
| double | b ) |
Returns 1.0 if a is less than or eqaul to b.
Otherwise 0.0 is returned.
| a | Input double |
| b | Input double |
Referenced by Isis::Calculator::LessThanOrEqual().
| double Isis::MaximumOperator | ( | double | a, |
| double | b ) |
Returns the max of a and b.
| a | First input value |
| b | Second input value |
Referenced by Isis::Calculator::MaximumPixel().
| double Isis::MinimumOperator | ( | double | a, |
| double | b ) |
Returns the min of a and b.
| a | First input value |
| b | Second input value |
Referenced by Isis::Calculator::MinimumPixel().
| double Isis::ModulusOperator | ( | double | a, |
| double | b ) |
Returns the modulus of a by b.
| a | Input modulee |
| b | Input modulator |
References Round().
Referenced by Isis::Calculator::Modulus().
| double Isis::MultiplyOperator | ( | double | a, |
| double | b ) |
Returns the result of a multiplied by b.
| a | Input double |
| b | Input double |
Referenced by Isis::Calculator::Multiply().
| double Isis::NegateOperator | ( | double | a | ) |
Returns the nagative of the input parameter.
| a | Input double |
Referenced by Isis::Calculator::Negative().
| double Isis::NotEqualOperator | ( | double | a, |
| double | b ) |
Returns 1.0 is a is not equal to b.
Otherwise 0.0 is returned.
| a | Input double |
| b | Input double |
Referenced by Isis::Calculator::NotEqual().
Multiply this angle by a double and return the resulting angle.
If this is an invalid angle, then the result will be an invalid angle.
| mult | The value to multiply to this angle |
| angle | The angle being multiplied by mult |
| Displacement Isis::operator* | ( | double | mult, |
| Displacement | displacement ) |
Multiply displacement by a value (5m * 2 = 10m).
| mult | This is the value to multiply by |
| displacement | This is the distance to multiply into |
Multiply this distance by a value (5m * 2 = 10m).
| mult | This is the value to multiply by |
| dist | This is the distance to multiply into |
|
inline |
Summation operator for Coordinate.
| A | First operand |
| B | Second operand |
References Isis::Coordinate::isValid(), Isis::Coordinate::m_x, and Isis::Coordinate::m_y.
|
inline |
Operator to sum two radiometric parameters.
References Isis::Radiometric::m_gain, and Isis::Radiometric::m_shift.
|
inline |
Subtraction operator for Coordinate.
| A | First operand |
| B | Second operand |
References Isis::Coordinate::isValid(), Isis::Coordinate::m_x, and Isis::Coordinate::m_y.
| ostream & Isis::operator<< | ( | ostream & | os, |
| Matrix & | matrix ) |
Write the matrix to the output stream.
References Isis::Matrix::Columns(), and Isis::Matrix::Rows().
| ostream & Isis::operator<< | ( | ostream & | os, |
| Pipeline & | pipeline ) |
This is the output operator for a Pipeline, which enables things such as:
| os | The output stream (usually cout) |
| pipeline | The pipeline object to output |
References Isis::Pipeline::Application(), Isis::PipelineApplication::Enabled(), Isis::Pipeline::KeepTemporaryFiles(), Isis::Pipeline::Name(), Isis::PipelineApplication::Name(), Isis::PipelineApplication::ParamString(), Isis::Pipeline::Prepare(), Isis::Pipeline::Size(), and Isis::PipelineApplication::TemporaryFiles().
| QDataStream & Isis::operator<< | ( | QDataStream & | stream, |
| const MaximumLikelihoodWFunctions & | mlwf ) |
References Isis::MaximumLikelihoodWFunctions::write().
| QDataStream & Isis::operator<< | ( | QDataStream & | stream, |
| const MaximumLikelihoodWFunctions::Model & | modelEnum ) |
| QDataStream & Isis::operator<< | ( | QDataStream & | stream, |
| const SparseBlockColumnMatrix & | sbcm ) |
Writes matrix to binary disk file pointed to by QDataStream stream.
| stream | stream pointing to binary disk file |
| sbcm | SparseBlockColumnMatrix to write |
| QDataStream & Isis::operator<< | ( | QDataStream & | stream, |
| const SparseBlockMatrix & | sparseBlockMatrix ) |
Writes matrix to binary disk file pointed to by QDataStream stream.
| stream | stream pointing to binary disk file |
| sparseBlockMatrix | SparseBlockMatrix to write |
| QDataStream & Isis::operator<< | ( | QDataStream & | stream, |
| const SparseBlockRowMatrix & | sbrm ) |
Writes matrix to binary disk file pointed to by QDataStream stream.
| stream | stream pointing to binary disk file |
| sbrm | SparseBlockRowMatrix to write |
| QDataStream & Isis::operator<< | ( | QDataStream & | stream, |
| const StatCumProbDistDynCalc & | scpddc ) |
References Isis::StatCumProbDistDynCalc::write().
| QDataStream & Isis::operator<< | ( | QDataStream & | stream, |
| const Statistics & | statistics ) |
References Isis::Statistics::write().
| QDebug Isis::operator<< | ( | QDebug | dbg, |
| const LinearAlgebra::Matrix & | matrix ) |
A global function to format a LinearAlgebra::Matrix as a QString and write it to a QDebug stream.
There will be 4 spaces between each matrix entry and each row is written on a new line.
| dbg | The stream where the vector will be written. |
| matrix | The matrix to be written. |
References toString().
| QDebug Isis::operator<< | ( | QDebug | dbg, |
| const LinearAlgebra::Vector & | vector ) |
A global function to format a LinearAlgebra::Vector as a QString and writes it to a QDebug stream.
| dbg | The stream where the vector will be written. |
| vector | The vector to be written. |
References toString().
| QDebug Isis::operator<< | ( | QDebug | dbg, |
| const SparseBlockColumnMatrix & | sbcm ) |
Writes matrix to QDebug stream.
| dbg | debug stream |
| sbcm | SparseBlockColumnMatrix to write to debug stream |
| QDebug Isis::operator<< | ( | QDebug | dbg, |
| const SparseBlockMatrix & | m ) |
Writes matrix to QDebug stream.
| dbg | debug stream |
| m | SparseBlockMatrix to write to debug stream |
| QDebug Isis::operator<< | ( | QDebug | dbg, |
| const SparseBlockRowMatrix & | sbrm ) |
Writes matrix to QDebug stream.
| dbt | debug stream |
| sbcm | SparseBlockRowMatrix to write to debug stream |
| QDebug Isis::operator<< | ( | QDebug | dbg, |
| const TNT::Array1D< SpiceDouble > & | tntArray ) |
Enables any TNT array of SpiceDoubles to be passed into qDebug() directly.
Valid inputs include NaifVector and NaifVertex. Array values will be printed on a single line with precision=15 digits.
| tntArray | TNT array to be printed. |
References toString().
| QDebug Isis::operator<< | ( | QDebug | dbg, |
| const TNT::Array2D< SpiceDouble > & | tntMatrix ) |
Enables any 2 dimensional TNT array of SpiceDoubles to be passed into qDebug() directly.
Valid inputs include NaifTriangle. Each row will be indented 4 spaces and each entry will be printed with precision=15 digits.
| tntMatrix | Two dimensional TNT array to be printed. |
References toString().
| QDebug Isis::operator<< | ( | QDebug | debug, |
| const Hillshade & | hillshade ) |
Print this class out to a QDebug object.
References Isis::Hillshade::azimuth(), Isis::Hillshade::resolution(), Isis::Angle::toString(), toString(), and Isis::Hillshade::zenith().
Referenced by Isis::SessionLog::operator<<.
| std::ostream & Isis::operator<< | ( | std::ostream & | os, |
| Isis::OverlapStatistics & | stats ) |
Creates a pvl of various useful data obtained by the overlap statistics class.
The pvl is returned in an output stream
| os | The output stream to write to |
| stats | The OverlapStatistics object to write to os |
References Isis::OverlapStatistics::toPvl().
| std::ostream & Isis::operator<< | ( | std::ostream & | os, |
| Isis::SessionLog & | log ) |
| std::ostream & Isis::operator<< | ( | std::ostream & | os, |
| Matrix & | matrix ) |
| QDataStream & Isis::operator>> | ( | QDataStream & | stream, |
| MaximumLikelihoodWFunctions & | mlwf ) |
References Isis::MaximumLikelihoodWFunctions::read().
| QDataStream & Isis::operator>> | ( | QDataStream & | stream, |
| MaximumLikelihoodWFunctions::Model & | modelEnum ) |
| QDataStream & Isis::operator>> | ( | QDataStream & | stream, |
| SparseBlockColumnMatrix & | sbcm ) |
Reads matrix from binary disk file pointed to by QDataStream stream.
| stream | stream pointing to binary disk file |
| sbcm | SparseBlockColumnMatrix to read |
References Isis::SparseBlockColumnMatrix::insertMatrixBlock().
| QDataStream & Isis::operator>> | ( | QDataStream & | stream, |
| SparseBlockMatrix & | sparseBlockMatrix ) |
Reads matrix from binary disk file pointed to by QDataStream stream.
| stream | stream pointing to binary disk file |
| sparseBlockMatrix | SparseBlockMatrix to read |
References Isis::SparseBlockMatrix::setNumberOfColumns().
| QDataStream & Isis::operator>> | ( | QDataStream & | stream, |
| SparseBlockRowMatrix & | sbrm ) |
Reads matrix from binary disk file pointed to by QDataStream stream.
| stream | stream pointing to binary disk file |
| sbcm | SparseBlockColumnMatrix to read |
References Isis::SparseBlockRowMatrix::insertMatrixBlock().
| QDataStream & Isis::operator>> | ( | QDataStream & | stream, |
| StatCumProbDistDynCalc & | scpddc ) |
References Isis::StatCumProbDistDynCalc::read().
| QDataStream & Isis::operator>> | ( | QDataStream & | stream, |
| Statistics & | statistics ) |
References Isis::Statistics::read().
| std::istream & Isis::operator>> | ( | std::istream & | is, |
| CSVReader & | csv ) |
Input read operator for input stream sources.
This input operator can be invoked directly from the users environment to read the complete input source. It can also be used to augment an existing source as this technique does not discard existing data (lines).
It is presumed that any additional input sources are consistant to pre-established parsing guidelines otherwise, the integrity of the table is compromized.
Here is an example of how to use this method:
| is | Input stream source |
| csv | CSVReader object to read input source lines from |
| Kernel::Type Isis::operator| | ( | Kernel::Type | a, |
| Kernel::Type | b ) |
Logical operator for combining Type flags.
| a | The first Type flag. |
| b | The second Type flag. |
| nlohmann::json Isis::pvlContainerToJSON | ( | PvlContainer & | container | ) |
Convert the contents of a PvlContainer to a JSON object.
Any comments in the container will be stored in "Comment". Comments associated with keywords will be stored inside their json object. If a keyword is repeated in the container, then the instances will be packed into an array in the order that they occur.
This function is used by the PvlGroup, PvlObject, and Pvl conversion functions; see their documentation for examples.
| container | The container to convert |
References pvlKeywordToJSON().
Referenced by pvlGroupToJSON(), and pvlObjectToJSON().
| nlohmann::json Isis::pvlGroupToJSON | ( | PvlGroup & | group | ) |
Convert the contents of a PvlGroup to a JSON object.
Any comments in the group will be stored in "Comment". Comments associated with keywords will be stored inside their json object.
A simple example group
PvlGroup:
Group = TestGroup TestKey1 = A TestKey2 = 1 End_Group
JSON:
{"TestKey1":{"Value":"A"},
"TestKey2":{"Value":"1"}}
If a keyword is repeated in the group, then the instances will be packed into an array in the order that they occur.
An example group with repeated keywords
PvlGroup:
Group = TestGroup TestKey1 = A TestKey2 = 1 TestKey2 = 2 End_Group
JSON:
{"TestKey1":{"Value":"A"},
"TestKey2":[{"Value":"1"},
{"Value":"2"}]}
| group | The group to convert |
References pvlContainerToJSON().
Referenced by pvlObjectToJSON().
| nlohmann::json Isis::pvlKeywordToJSON | ( | PvlKeyword & | keyword | ) |
Convert the contents of a PvlKeyword to a JSON object.
All values from the keyword will be stored in "Value", all units will be stored in "Units", and all comments will be stored in "Comment".
How a keyword with only a value is converted
PvlKeyword:
ExposureDuration = 10
JSON:
{"Value":"10"}
How single values, units, and comments are converted
PvlKeyword:
# The exposure duration of the image ExposureDuration = 10 <ms>
JSON:
{"Comment":"# The exposure duration of the image",
"Units":"ms",
"Value":"10"}
How multiple values, units, and comments are converted
PvlKeyword:
# First comment
# Second comment
TestKey2 = ("This keyword has multiple comments" <first unit>,
"It also has multiple values",
"It even has values with and without units" <third unit>)
JSON:
{"Comment":["# First comment",
"# Second comment"],
"Units":["first unit",
"",
"third unit"],
"Value":["This keyword has multiple comments",
"It also has multiple values",
"It even has values with and without units"]}
| keyword | The keyword to convert |
Referenced by pvlContainerToJSON().
| nlohmann::json Isis::pvlObjectToJSON | ( | PvlObject & | object | ) |
Convert the contents of a PvlObject to a JSON object.
Any comments in the base object will be stored in "Comment". Comments associated with keywords, groups, or nested objects will be stored inside their associated JSON object.
An example demonstrating how nested objects and groups are converted
PvlObject:
Object = TestObject2
TestKey3 = "hello world"
Object = TestObject1
TestKey1 = A
TestKey2 = 1
End_Object
Group = TestGroup
TestKey3 = "hello world"
End_Group
End_Object
JSON:
{"TestGroup":{"TestKey3":{"Value":"hello world"}},
"TestKey3":{"Value":"hello world"},
"TestObject1":{"TestKey1":{"Value":"A"},
"TestKey2":{"Value":"1"}}}
If there are keywords, groups, and/or nested objects with the same name at the same level in the object, then they will be stored in an array starting with the keywords, followed by the groups, and then finally the objects. Within each subset, the repeated elements will be ordered the same as they occur in the object.
An example with repeated element names at the same level
PvlObject:
Object = TestObject2
TestKey3 = "hello world"
TestGroup = Q
Object = TestObject1
TestKey1 = A
TestKey2 = 1
End_Object
Object = TestGroup
TestKey2 = 1
End_Object
Group = TestGroup
TestKey3 = "hello world"
End_Group
End_Object
JSON:
{"TestGroup":[{"Value":"Q"},
{"TestKey3":{"Value":"hello world"}},
{"TestKey2":{"Value":"1"}}],
"TestKey3":{"Value":"hello world"},
"TestObject1":{"TestKey1":{"Value":"A"},
"TestKey2":{"Value":"1"}}}
| object | The object to convert |
References pvlContainerToJSON(), pvlGroupToJSON(), and pvlObjectToJSON().
Referenced by fitsToJson(), pvlObjectToJSON(), and pvlToJSON().
| nlohmann::json Isis::pvlToJSON | ( | Pvl & | pvl | ) |
Convert the contents of a Pvl to a JSON object.
Any comments in the root of the Pvl will be stored in "Comment". Comments associated with keywords, groups, or objects will be stored inside their associated JSON object. If there are keywords, groups, and/or objects with the same name at the same level in the Pvl, then they will be stored in an array starting with the keywords, followed by the groups, and then finally the objects. Within each subset, the repeated elements will be ordered the same as they occur in the object.
| pvl | The Pvl to convert |
References pvlObjectToJSON().
Referenced by pvlToJSON().
| nlohmann::json Isis::pvlToJSON | ( | QString | pvlFile | ) |
Converts an PVL file to a json object.
| pvlFile | Path to an PVL file. |
References pvlToJSON().
Rebins a vector to a different size.
This function can rebin to both larger and smaller sizes. It fits the data to a cubic spline and then computes the value at the rebin pixel index. One advantage to this approach is that on input, special pixels are ignored - on output there will never be special pixels unless there are not enough points to conpute the cubic spline on which case this function throws an exception.
| v | Input vector to rebin |
| n | Size of the new output vector |
References Isis::NumericalApproximation::AddData(), Isis::NumericalApproximation::CubicNatural, Isis::NumericalApproximation::Evaluate(), and Isis::NumericalApproximation::NearestEndpoint.
|
inline |
Deletes HiRISE specific BLOBS from cube file.
Ths function removes only the HiRISE specific
| label | Input label associated with file from which to remove the HiRISE blobs |
| int Isis::Round | ( | double | a | ) |
Returns the result of rounding the input a to the closest integer.
| a | Inut double |
Referenced by BitwiseAndOperator(), BitwiseOrOperator(), and ModulusOperator().
| void Isis::sanitize | ( | std::string & | input | ) |
Referenced by stateAsJson().
| double Isis::SecantOperator | ( | double | a | ) |
Returns the secant of the input a.
| a | Input double |
Referenced by Isis::Calculator::Secant().
| void Isis::setStringAttribute | ( | int | locationId, |
| QString | locationName, | ||
| QString | attributeName, | ||
| QString | attributeValue ) |
|
inline |
Checks profile flag to skip the current Module.
This function looks for the keyword Debug::SkipModule and checks its value. True is returned if the value is TRUE (case insensentive).
| prof | Module profile from config file |
References IsTrueValue().
| json Isis::stateAsJson | ( | std::string | modelState | ) |
References sanitize().
| double Isis::SubtractOperator | ( | double | a, |
| double | b ) |
Returns the result of subtracting b from a.
| a | Input subtractee |
| b | Input subtractor |
Referenced by Isis::Calculator::Subtract().
| double Isis::ToDouble | ( | const T & | value | ) |
Helper function to convert values to doubles.
| T | Type of value to convert |
| value | Value to convert |
Referenced by Isis::LoadCSV::load(), and Isis::ZeroBufferFit::ZeroBufferFit().
| int Isis::ToInteger | ( | const T & | value | ) |
Helper function to convert values to Integers.
| T | Type of value to convert |
| value | Value to convert |
Referenced by Isis::LoadCSV::load(), and Isis::ZeroBufferFit::ZeroBufferFit().
| QString Isis::ToString | ( | const T & | value | ) |
Helper function to convert values to strings.
| T | Type of value to convert |
| value | Value to convert |
References toString().
Referenced by Isis::ZeroBufferFit::guess(), Isis::LoadCSV::load(), Isis::ZeroBufferFit::Normalize(), Isis::ZeroBufferFit::Solve(), and Isis::ZeroBufferFit::ZeroBufferFit().
| QString Isis::toString | ( | const LinearAlgebra::Vector & | vector, |
| int | precision ) |
A global function to format LinearAlgebra::Vector as a QString with the given precision.
The string will be comma-separated entries encased by parentheses.
| vector | The vector to be converted. |
| precision | Number of significant figures to convert. |
References toString().
Referenced by Isis::LinearAlgebra::add(), Isis::LroWideAngleCameraFocalPlaneMap::addFilter(), Isis::Gruen::AlgorithmStatistics(), Isis::ApolloMetricCamera::ApolloMetricCamera(), Isis::ApolloPanoramicCamera::ApolloPanoramicCamera(), Isis::Application::Application(), Isis::Equalization::applyCorrection(), Isis::BundleControlPoint::applyParameterCorrections(), Isis::Strategy::applyToIntersectedGeometry(), Isis::Cube::attachSpiceFromIsd(), Isis::CubeAttributeInput::bands(), Isis::Camera::BasicMapping(), Isis::Camera::basicRingMapping(), Isis::FunctionTools::brentsRootFinder(), Isis::CsmBundleObservation::bundleOutputCSV(), Isis::IsisBundleObservation::bundleOutputCSV(), Isis::CsmBundleObservation::bundleOutputString(), Isis::IsisBundleObservation::bundleOutputString(), Isis::SpiceRotation::CacheLabel(), Isis::Equalization::calculateBandStatistics(), Isis::Equalization::calculateOverlapStatistics(), Isis::Process::CalculateStatistics(), Isis::HiEqualization::calculateStatistics(), Isis::PushFrameCameraCcdLayout::ccdLines(), Isis::PushFrameCameraCcdLayout::ccdSamples(), CcdToFilter(), Isis::Chandrayaan1M3Camera::Chandrayaan1M3Camera(), Isis::Chandrayaan2OhrcCamera::Chandrayaan2OhrcCamera(), Isis::Chandrayaan2TmcCamera::Chandrayaan2TmcCamera(), Isis::LightTimeCorrectionState::checkAberrationCorrection(), Isis::QtExporter::checkDataSize(), Isis::XmlToPvlTranslationManager::checkDependencies(), Isis::LightTimeCorrectionState::checkLightTimeToSurfaceCorrect(), Isis::LightTimeCorrectionState::checkObserverTargetSwap(), Isis::ProcessImport::CheckPixelRange(), Isis::ProcessImport::CheckVsiIo(), cholmodErrorHandler(), Isis::ClipperPushBroomCamera::ClipperPushBroomCamera(), Isis::LinearAlgebra::column(), Isis::ControlNetDiff::compare(), Isis::ControlNetDiff::compare(), Isis::CsmBundleObservation::computePoint3DPartials(), Isis::BundleResults::computeSigma0(), Isis::CameraStatistics::constructKeyword(), Isis::ControlPointList::ControlPointId(), Isis::ControlPointList::ControlPointList(), Isis::BundleSettings::convergenceCriteriaToString(), Isis::TiffImporter::convertProjection(), Isis::SurfacePoint::coordinateTypeToString(), Isis::Control::copyToNewProjectRoot(), CpmmToCcd(), Isis::Cube::create(), Isis::ShapeModelFactory::create(), Isis::ProjectionFactory::CreateForCube(), Isis::ProjectionFactory::CreateForCube(), IsisAml::CreatePVL(), Isis::CrismCamera::CrismCamera(), Isis::LinearAlgebra::crossProduct(), Isis::BundleObservationSolveSettings::csmSolveOptionToString(), Isis::BundleObservationSolveSettings::csmSolveSetToString(), Isis::BundleObservationSolveSettings::csmSolveTypeToString(), Isis::CTXCamera::CTXCamera(), Isis::ControlNetFilter::CubeDistanceFilter(), Isis::ControlMeasureLogData::DataTypeToName(), Isis::DawnFcCamera::DawnFcCamera(), Isis::DawnVirCamera::DawnVirCamera(), Isis::iTime::DayOfYearString(), Isis::iTime::DayString(), Isis::PolynomialUnivariate::DerivativeCoef(), Isis::LinearAlgebra::determinant(), Isis::SpiceRotation::DPckPolynomial(), Isis::SpicePosition::DPolynomial(), Isis::SpiceRotation::DPolynomial(), Isis::ControlNetVitals::emitHistoryEntry(), Isis::Equirectangular::Equirectangular(), Isis::Equalization::errorCheck(), Isis::HiEqualization::errorCheck(), Isis::iTime::EtString(), Isis::BasisFunction::Evaluate(), Isis::ProcessExportPds::ExportTable(), Isis::ExportPdsTable::exportTable(), Isis::Chip::Extract(), Isis::ProcessExportPds4::fileAreaObservational(), Isis::SerialNumberList::fileName(), Isis::PlotWindow::fillTable(), Isis::InterestOperator::FindCnetRef(), Isis::ProcessExportPds::FixedJP2ImageRoot(), Isis::BundleControlPoint::formatBundleLatitudinalOutputDetailString(), Isis::BundleControlPoint::formatBundleOutputDetailString(), Isis::BundleTargetBody::formatBundleOutputString(), Isis::BundleControlPoint::formatBundleRectangularOutputDetailString(), Isis::SpiceRotation::FrameTrace(), Isis::OriginalXmlLabel::fromBlob(), Isis::ControlNetStatistics::GenerateControlNetStats(), Isis::PvlFlatMap::get(), Isis::CubeViewport::getAllWhatsThisInfo(), Isis::Spice::getClockTime(), Isis::ImportPdsTable::getColumnName(), Isis::SurfacePoint::GetCoord(), Isis::LeastSquares::GetExpected(), Isis::PushFrameCameraCcdLayout::getFrameInfo(), Isis::EmbreeTargetShape::getHitInformation(), Isis::LeastSquares::GetInput(), Isis::ControlPoint::GetMeasure(), Isis::ControlPoint::GetMeasure(), Isis::Equalization::getResults(), Isis::SurfacePoint::GetSigma(), Isis::SurfacePoint::GetSigmaDistance(), Isis::SqlRecord::getValue(), Isis::SqlRecord::getValue(), Isis::SurfacePoint::GetWeight(), Isis::ControlNet::GraphToString(), Isis::HayabusaAmicaCamera::HayabusaAmicaCamera(), Isis::HayabusaNirsCamera::HayabusaNirsCamera(), Isis::HiresCamera::HiresCamera(), Isis::iTime::HourString(), Isis::HrscCamera::HrscCamera(), Isis::Hyb2OncCamera::Hyb2OncCamera(), Isis::LinearAlgebra::identity(), Isis::Strategy::importGeometry(), Isis::ControlNetValidMeasure::InitStdOptionsGroup(), Isis::LinearAlgebra::innerProduct(), Isis::BundleObservationSolveSettings::instrumentPointingSolveOptionToString(), Isis::BundleObservationSolveSettings::instrumentPositionSolveOptionToString(), Isis::IssNACamera::IssNACamera(), Isis::IssWACamera::IssWACamera(), Isis::JunoCamera::JunoCamera(), Isis::KaguyaMiCamera::KaguyaMiCamera(), Isis::KaguyaTcCamera::KaguyaTcCamera(), Isis::KaguyaTcCameraDistortionMap::KaguyaTcCameraDistortionMap(), Isis::LambertConformal::LambertConformal(), Isis::Equalization::loadInputs(), Isis::Equalization::loadOutputs(), Isis::SpiceRotation::loadPCFromSpice(), Isis::TProjection::LocalRadius(), Isis::ControlNetValidMeasure::LocationString(), Isis::LroNarrowAngleCamera::LroNarrowAngleCamera(), Isis::LroWideAngleCameraDistortionMap::LroWideAngleCameraDistortionMap(), Isis::LwirCamera::LwirCamera(), Isis::ControlNetDiff::makeKeyword(), Isis::IProj::Mapping(), Isis::Planar::Mapping(), Isis::RingCylindrical::Mapping(), Isis::MarciCamera::MarciCamera(), Isis::MarciDistortionMap::MarciDistortionMap(), Isis::Mariner10Camera::Mariner10Camera(), Isis::MdisCamera::MdisCamera(), Isis::ControlMeasure::MeasureTypeToString(), Isis::Mercator::Mercator(), Isis::MexHrscSrcCamera::MexHrscSrcCamera(), Isis::iTime::MinuteString(), Isis::BundleAdjust::modelState(), Isis::MaximumLikelihoodWFunctions::modelToString(), Isis::Mollweide::Mollweide(), Isis::iTime::MonthString(), Isis::MsiCamera::MsiCamera(), Isis::LinearAlgebra::multiply(), Isis::LinearAlgebra::multiply(), Isis::NewHorizonsLorriCamera::NewHorizonsLorriCamera(), Isis::NewHorizonsMvicTdiCamera::NewHorizonsMvicTdiCamera(), Isis::NirCamera::NirCamera(), Isis::ObliqueCylindrical::ObliqueCylindrical(), Isis::ObservationNumberList::observationNumber(), Isis::SerialNumberList::observationNumber(), Isis::ObservationNumberList::observationNumberMapIndex(), Isis::BundleSettings::observationSolveSettings(), Isis::Cube::openCube(), operator<<(), operator<<(), operator<<(), operator<<(), operator<<(), Isis::Orthographic::Orthographic(), Isis::OsirisRexOcamsCamera::OsirisRexOcamsCamera(), Isis::OsirisRexTagcamsCamera::OsirisRexTagcamsCamera(), Isis::OsirisRexTagcamsDistortionMap::OsirisRexTagcamsDistortionMap(), Isis::LinearAlgebra::outerProduct(), Isis::BundleSolutionInfo::outputHeader(), Isis::BundleSolutionInfo::outputImagesCSV(), Isis::ProcessExportPds::OutputLabel(), Isis::ProcessMosaic::OverlayToString(), Isis::LatLonGridTool::paintViewport(), Isis::IsisBundleObservation::parameterList(), Isis::InterestOperator::Parse(), Isis::SurfacePoint::Partial(), Isis::Cube::physicalBand(), Isis::TrackingTable::pixelToFileName(), Isis::TrackingTable::pixelToSN(), Isis::Planar::Planar(), Isis::GridPolygonSeeder::PluginParameters(), Isis::LimitPolygonSeeder::PluginParameters(), Isis::PolygonSeeder::PluginParameters(), Isis::StripPolygonSeeder::PluginParameters(), Isis::PointPerspective::PointPerspective(), Isis::ControlNetFilter::PointPixelShiftFilter(), Isis::PolarStereographic::PolarStereographic(), Isis::Project::Project(), Isis::LinearAlgebra::project(), IsisAml::PutDouble(), IsisAml::PutInteger(), Isis::Target::radiiGroup(), Isis::JP2Decoder::Read(), Isis::JP2Decoder::Read(), Isis::EmbreeTargetShape::readDSK(), Isis::OriginalXmlLabel::readFromXmlFile(), Isis::MosaicControlNetToolMovementConfigDialog::readSettings(), Isis::ControlPointList::RegisterStatistics(), Isis::AutoReg::RegistrationStatistics(), Isis::RingCylindrical::RingCylindrical(), Isis::ProjectionFactory::RingsCreateForCube(), Isis::ProjectionFactory::RingsCreateForCube(), Isis::ProcessMapMosaic::RingsSetOutputCube(), Isis::ProcessMapMosaic::RingsSetOutputCube(), Isis::ProcessMapMosaic::RingsSetOutputCube(), Isis::Robinson::Robinson(), Isis::RosettaOsirisCamera::RosettaOsirisCamera(), Isis::RosettaVirtisCamera::RosettaVirtisCamera(), Isis::LinearAlgebra::rotate(), Isis::LinearAlgebra::row(), Isis::ProgramLauncher::RunIsisProgram(), Isis::ProgramLauncher::RunSystemCommand(), Isis::Stretch::Save(), Isis::BundleObservationSolveSettings::save(), Isis::BundleResults::save(), Isis::BundleSettings::save(), Isis::MosaicSceneWidget::save(), Isis::StatCumProbDistDynCalc::save(), Isis::Statistics::save(), Isis::ControlMeasureEditWidget::saveChips(), Isis::ControlPointEdit::saveChips(), Isis::SerialNumberList::serialNumber(), Isis::SerialNumberList::SerialNumberList(), Isis::Latitude::setAngle(), Isis::AtmosModel::SetAtmosHnorm(), Isis::JP2Exporter::setBuffer(), Isis::TiffExporter::setBuffer(), Isis::BasisFunction::SetCoefficients(), Isis::LinearAlgebra::setColumn(), Isis::ProcessImport::SetDataHeaderBytes(), Isis::ProcessImport::SetDataPrefixBytes(), Isis::ProcessImport::SetDataSuffixBytes(), Isis::ProcessImport::SetDataTrailerBytes(), Isis::ProcessImport::SetDimensions(), Isis::CameraDistortionMap::SetDistortion(), Isis::JunoDistortionMap::SetDistortion(), Isis::KaguyaMiCameraDistortionMap::SetDistortion(), Isis::LoHighDistortionMap::SetDistortion(), Isis::LoMediumDistortionMap::SetDistortion(), Isis::LroNarrowAngleDistortionMap::SetDistortion(), Isis::OsirisRexDistortionMap::SetDistortion(), Isis::OsirisRexOcamsDistortionMap::SetDistortion(), Isis::ShadowCamDistortionMap::SetDistortion(), Isis::TaylorCameraDistortionMap::SetDistortion(), Isis::ProcessImport::SetFileHeaderBytes(), Isis::ProcessImport::SetFileTrailerBytes(), Isis::Camera::SetFocalLength(), Isis::Pipeline::SetInputListFile(), Isis::LineManager::SetLine(), Isis::SurfacePoint::SetMatrix(), Isis::CubeAttributeOutput::setMaximum(), Isis::CubeAttributeOutput::setMinimum(), Isis::ProcessMapMosaic::SetOutputCube(), Isis::ProcessMapMosaic::SetOutputCube(), Isis::ProcessMapMosaic::SetOutputCube(), Isis::LunarLambertEmpirical::SetPhotoPhaseList(), Isis::LunarLambertEmpirical::SetPhotoPhaseList(), Isis::MinnaertEmpirical::SetPhotoPhaseList(), Isis::Camera::SetPixelPitch(), Isis::ExportDescription::setPixelType(), Isis::Latitude::setPlanetographic(), Isis::Chip::SetReadInterpolator(), Isis::ControlPoint::SetRefMeasure(), Isis::Equalization::setResults(), Isis::LinearAlgebra::setRow(), Isis::BundleControlPoint::setSigmaWeightFromGlobals(), Isis::Chip::SetSize(), Isis::ControlPoint::SetType(), Isis::Projection::SetUpperLeftCorner(), Isis::Chip::SetValidRange(), Isis::Statistics::SetValidRange(), Isis::ShadowCamCamera::ShadowCamCamera(), Isis::SimpleCylindrical::SimpleCylindrical(), Isis::Sinusoidal::Sinusoidal(), Isis::SerialNumberList::spacecraftInstrumentId(), Isis::SpiceRotation::SpiceRotation(), Isis::SsiCamera::SsiCamera(), Isis::ProcessExportPds4::StandardAllMapping(), Isis::ProcessExportPds::StandardAllMapping(), Isis::ProcessExportPds::StandardImageImage(), Isis::ProcessExportPds::StandardJP2Image(), Isis::PolygonSeeder::StandardTests(), Isis::ProcessMosaic::StartProcess(), Isis::Spice::storeValue(), Isis::ProcessExportPds::StreamJP2ImageRoot(), Isis::LinearAlgebra::subtract(), Isis::BundleSolutionInfo::surfacePointCoordName(), Isis::Target::Target(), Isis::BundleTargetBody::targetRadiiOptionToString(), Isis::Stretch::Text(), Isis::TgoCassisCamera::TgoCassisCamera(), Isis::TgoCassisDistortionMap::TgoCassisDistortionMap(), Isis::TProjection::To180Domain(), Isis::TProjection::To360Domain(), Isis::LinearAlgebra::toAxisAngle(), Isis::RingPlaneProjection::ToClockwise(), Isis::LinearAlgebra::toEulerAngles(), Isis::ControlMeasureLogData::ToKeyword(), Isis::LinearAlgebra::toMatrix(), Isis::LinearAlgebra::toMatrix(), Isis::LinearAlgebra::toMatrix(), Isis::LinearAlgebra::toMatrix(), Isis::TProjection::ToPlanetocentric(), Isis::TProjection::ToPlanetographic(), Isis::TProjection::ToPositiveEast(), Isis::TProjection::ToPositiveWest(), Isis::CameraStatistics::toPvl(), Isis::ControlNetVersioner::toPvl(), Isis::ImageFileListWidget::toPvl(), Isis::MosaicAreaTool::toPvl(), Isis::MosaicControlNetTool::toPvl(), Isis::MosaicFindTool::toPvl(), Isis::MosaicGridTool::toPvl(), Isis::MosaicSceneWidget::toPvl(), Isis::MultivariateStatistics::toPvl(), Isis::OverlapStatistics::toPvl(), Isis::Statistics::toPvl(), Isis::LinearAlgebra::toQuaternion(), ToString(), Isis::Angle::toString(), Isis::Distance::toString(), toString(), toString(), Isis::TProjection::TProjection(), Isis::XmlToPvlTranslationManager::Translate(), Isis::ProcessExportPds4::translateBandBinSpectrumUniform(), Isis::ProcessImportPds::TranslatePdsProjection(), Isis::TransverseMercator::TransverseMercator(), Isis::ControlHealthMonitorWidget::update(), Isis::AutoReg::UpdatedTemplate(), Isis::AlphaCube::UpdateGroup(), Isis::SubArea::UpdateLabel(), Isis::CubeTileHandler::updateLabels(), Isis::Enlarge::UpdateOutputLabel(), Isis::Reduce::UpdateOutputLabel(), Isis::UvvisCamera::UvvisCamera(), Isis::ControlNetVitals::validate(), Isis::StatCumProbDistDynCalc::validate(), Isis::ControlNetValidMeasure::ValidatePvlDN(), Isis::ControlNetValidMeasure::ValidatePvlEmissionAngle(), Isis::ControlNetValidMeasure::ValidatePvlFromEdge(), Isis::ControlNetValidMeasure::ValidatePvlIncidenceAngle(), Isis::ControlNetValidMeasure::ValidatePvlResidualTolerances(), Isis::ControlNetValidMeasure::ValidatePvlResolution(), Isis::ControlNetValidMeasure::ValidatePvlShiftTolerances(), Isis::ControlNetValidMeasure::ValidStandardOptions(), Isis::StatCumProbDistDynCalc::value(), Isis::TriangularPlate::vertex(), Isis::ControlHealthMonitorWidget::viewImageAll(), Isis::ControlHealthMonitorWidget::viewImageFewMeasures(), Isis::ControlHealthMonitorWidget::viewImageHullTolerance(), Isis::ControlHealthMonitorWidget::viewPointAll(), Isis::ControlHealthMonitorWidget::viewPointConstrained(), Isis::ControlHealthMonitorWidget::viewPointEditLocked(), Isis::ControlHealthMonitorWidget::viewPointFewMeasures(), Isis::ControlHealthMonitorWidget::viewPointFixed(), Isis::ControlHealthMonitorWidget::viewPointFree(), Isis::ControlHealthMonitorWidget::viewPointIgnored(), Isis::VikingCamera::VikingCamera(), Isis::MaximumLikelihoodWFunctions::weightedResidualCutoff(), Isis::JP2Encoder::Write(), Isis::JP2Encoder::Write(), Isis::ControlNetVersioner::write(), Isis::Cube::write(), Isis::iTime::YearString(), and Isis::Statistics::ZScore().
| QString Isis::toString | ( | const TNT::Array1D< SpiceDouble > & | naifArray, |
| int | precision ) |
Formats any TNT array of SpiceDoubles as a string with given precision.
Valid inputs include NaifVector and NaifVertex. The array in the output string will be comma separated and enclosed in parentheses.
| tntArray | TNT array to be formatted as a string. |
| precision | Number of digits each value in the array will be stored with. |
References toString().
| bool Isis::validate | ( | const NaifTriangle & | t | ) |
Verifies that the given NaifTriangle is 3 x 3.
| t | NaifTriangle to validate. |
| bool Isis::validate | ( | const NaifVertex & | v | ) |
Verifies that the given NaifVector or NaifVertex is 3 dimensional.
Also acceptable: bool validate(const NaifVector &v).
| v | Input can be a NaifVertex or NaifVector to validate. |
Referenced by Isis::Intercept::isValid(), Isis::NaifDskPlateModel::plateIdOfIntercept(), and Isis::BundleSettings::setValidateNetwork().
|
inline |
Counts number of valid pixels in vector.
| v | Vector to inspect |
| nlohmann::json Isis::xmlToJson | ( | QDomDocument & | doc | ) |
Converts an XML document stored in a QDomDocument into a JSON object.
| doc | A QDomDocument with an XML file loaded into it. |
References convertXmlToJson().
| nlohmann::json Isis::xmlToJson | ( | QString | xmlFile | ) |
Converts an XML file to a json object.
Please see other functions for details about how XML elements are converted to corresponding json elements.
| xmlFile | Path to an XML file. |
References Isis::OriginalXmlLabel::readFromXmlFile(), Isis::OriginalXmlLabel::ReturnLabels(), and xmlToJson().
Referenced by xmlToJson().
| const int Isis::AllMatchOrOne = 128 |
| const int Isis::BandMatchOrOne = 32 |
|
static |
Referenced by Isis::PolygonTools::CopyMultiPolygon(), Isis::PolygonTools::CopyMultiPolygon(), Isis::ImagePolygon::Create(), Isis::PolygonTools::Despike(), Isis::PolygonTools::Despike(), Isis::ImageOverlapSet::FindAllOverlaps(), Isis::PolygonTools::FixSeam(), Isis::PolygonTools::FixSeam(), Isis::RubberBandTool::geometry(), Isis::ImagePolygon::ImagePolygon(), Isis::PolygonTools::LatLonToSampleLine(), Isis::PolygonTools::LatLonToXY(), Isis::PolygonTools::MakeMultiPolygon(), Isis::ProcessGroundPolygons::Rasterize(), Isis::PolygonTools::ReducePrecision(), Isis::PolygonTools::ReducePrecision(), Isis::PolygonTools::ReducePrecision(), Isis::HistogramTool::refreshPlot(), Isis::LimitPolygonSeeder::Seed(), Isis::StripPolygonSeeder::Seed(), Isis::ProcessPolygons::SetStatCubes(), Isis::PolygonTools::SplitPolygonOn360(), Isis::PolygonTools::To180(), Isis::ProcessGroundPolygons::Vectorize(), and Isis::PolygonTools::XYToLatLon().
| Application * Isis::iApp = NULL |
Referenced by Isis::History::AddEntry(), Isis::Application::Application(), Isis::Progress::CheckStatus(), Isis::Application::GetUserInterface(), Isis::Application::GuiLog(), Isis::Application::GuiLog(), Isis::Application::GuiLog(), Isis::Application::HasParent(), Isis::Application::Log(), Isis::BundleAdjust::outputBundleStatus(), Isis::Gui::ShowWarning(), and Isis::Process::WriteHistory().
| const int Isis::OneBand = 16 |
Referenced by Isis::Process::CheckRequirements().
|
staticconstexpr |
Referenced by Isis::ShadowCamDistortionMap::SetUndistortedFocalPlane().
| const int Isis::ReadWrite = 64 |
Referenced by Isis::Process::SetInputCube().
| QString Isis::sBoolean = { "False", "True" } |
String values for Boolean.
Referenced by Isis::ControlNetStatistics::GeneratePointStats(), Isis::ControlNetFilter::PointCubeNamesFilter(), Isis::ControlNetFilter::PointEditLockFilter(), Isis::ControlNetFilter::PointGoodnessOfFitFilter(), Isis::ControlNetFilter::PointMeasurePropertiesFilter(), Isis::ControlNetFilter::PointMeasuresFilter(), Isis::ControlNetFilter::PointNumMeasuresEditLockFilter(), Isis::ControlNetFilter::PointPixelShiftFilter(), Isis::ControlNetFilter::PointResMagnitudeFilter(), and Isis::ControlNetFilter::PointStats().
| const int Isis::SizeMatch = 1 |
Referenced by Isis::Process::CheckRequirements().
| const int Isis::SpatialMatch = 2 |
Referenced by Isis::Process::CheckRequirements(), Isis::ProcessByLine::SetInputCube(), Isis::ProcessByLine::SetInputCube(), Isis::ProcessBySample::SetInputCube(), Isis::ProcessBySample::SetInputCube(), Isis::ProcessBySpectra::SetInputCube(), Isis::ProcessBySpectra::SetInputCube(), and Isis::ProcessByBrick::VerifyCubes().
| QString Isis::sPointType = { "Fixed", "Constrained", "Free" } |
String names for Point Type.
Referenced by Isis::ControlNetStatistics::GeneratePointStats(), Isis::ControlNetFilter::PointCubeNamesFilter(), Isis::ControlNetFilter::PointEditLockFilter(), Isis::ControlNetFilter::PointGoodnessOfFitFilter(), Isis::ControlNetFilter::PointPixelShiftFilter(), Isis::ControlNetFilter::PointResMagnitudeFilter(), and Isis::ControlNetFilter::PointStats().
|
staticconstexpr |
Referenced by Isis::ShadowCamDistortionMap::SetUndistortedFocalPlane().
| const QString Isis::trackingTableName = "InputImages" |
Referenced by Isis::TrackingTable::toTable().
| const int Isis::VIEWSIZE = 301 |
Constant representing the length and width of the chip viewports.
Referenced by Isis::ChipViewportsWidget::setPoint().